CAS 40870-52-8

2-(hydroxymethyl)-5-methylcyclohexa-2,5-diene-1,4-dione

Description:

2-(Hydroxymethyl)-5-methylcyclohexa-2,5-diene-1,4-dione, with the CAS number 40870-52-8, is an organic compound characterized by its unique bicyclic structure featuring both hydroxymethyl and methyl substituents. This compound contains a cyclohexadiene core with two ketone functional groups, which contribute to its reactivity and potential applications in organic synthesis. The presence of the hydroxymethyl group enhances its solubility in polar solvents and may influence its biological activity. The compound is likely to exhibit properties typical of diketones, such as being a potential electrophile in various chemical reactions. Additionally, its structural features suggest that it may participate in hydrogen bonding, affecting its physical properties like boiling and melting points. While specific data on its stability and reactivity may vary, compounds of this nature are often explored for their roles in synthetic organic chemistry and potential applications in pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₈H₈O₃

InChI: InChI=1/C8H8O3/c1-5-2-8(11)6(4-9)3-7(5)10/h2-3,9H,4H2,1H3

SMILES: CC1=CC(=O)C(=CC1=O)CO

Synonyms:

• 2,5-Cyclohexadiene-1,4-dione, 2- (hydroxymethyl)-5-methyl-
• 2-(HYDROXYMETHYL)-5-METHYLCYCLOHEXA-2,5-DIENE-1,4-DIONE
• 2-Hydroxymethyl-5-methyl-p-benzoquinone

2-(Hydroxymethyl)-5-methylcyclohexa-2,5-diene-1,4-dione

CAS: 40870-52-8

2-(Hydroxymethyl)-5-methylcyclohexa-2,5-diene-1,4-dione

Purity: ≥95%

Molecular weight: 152.15g/mol

Ref: 54-OR300266