CAS 40871-03-2

Methyl 2-methyl-3-[(3-phenylpropyl)amino]propanoate

Description:

Methyl 2-methyl-3-[(3-phenylpropyl)amino]propanoate, with the CAS number 40871-03-2, is an organic compound characterized by its ester functional group, which is typical of methyl esters. This compound features a branched alkyl chain and an amino group, contributing to its potential biological activity. The presence of the phenylpropyl group suggests that it may exhibit hydrophobic properties, influencing its solubility and interaction with biological membranes. The molecular structure indicates that it may participate in various chemical reactions, including esterification and amine reactivity. Its potential applications could span pharmaceuticals, where such compounds are often explored for their therapeutic effects, particularly in the context of drug design and synthesis. Additionally, the compound's specific stereochemistry and functional groups may play a crucial role in determining its reactivity and interaction with biological targets. Overall, Methyl 2-methyl-3-[(3-phenylpropyl)amino]propanoate represents a complex organic molecule with diverse chemical properties and potential applications in medicinal chemistry.

Formula: C₁₄H₂₁NO₂

InChI: InChI=1S/C14H21NO2/c1-12(14(16)17-2)11-15-10-6-9-13-7-4-3-5-8-13/h3-5,7-8,12,15H,6,9-11H2,1-2H3

InChI key: InChIKey=ISHNNDBUVZKUEY-UHFFFAOYSA-N

SMILES: C(CCNCC(C(OC)=O)C)C1=CC=CC=C1

Synonyms:

• Propanoic acid, 2-methyl-3-[(3-phenylpropyl)amino]-, methyl ester
• Methyl 2-methyl-3-[(3-phenylpropyl)amino]propanoate
• β-Alanine, 2-methyl-N-(3-phenylpropyl)-, methyl ester

methyl 2-methyl-3-[(3-phenylpropyl)amino]propanoate

CAS: 40871-03-2

Formula: C₁₄H₂₁NO₂

Purity: 95.0%

Molecular weight: 235.327

Ref: 10-F522917