CAS 40890-47-9

2-benzyl-4-chloro-5-methoxypyridazin-3(2H)-one

Description:

2-benzyl-4-chloro-5-methoxypyridazin-3(2H)-one is a chemical compound characterized by its pyridazine core, which is a six-membered heterocyclic ring containing two nitrogen atoms. This compound features a benzyl group, a chlorine atom, and a methoxy group, contributing to its unique chemical properties. The presence of the chlorine atom typically enhances the compound's reactivity, while the methoxy group can influence its solubility and polarity. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that may interact with biological targets. Additionally, the compound may exhibit specific biological activities, which can be explored through further research. Its CAS number, 40890-47-9, allows for easy identification and retrieval of information in chemical databases. Overall, 2-benzyl-4-chloro-5-methoxypyridazin-3(2H)-one represents a versatile structure with potential implications in various fields of chemistry and pharmacology.

Formula: C₁₂H₁₁ClN₂O₂

InChI: InChI=1/C12H11ClN2O2/c1-17-10-7-14-15(12(16)11(10)13)8-9-5-3-2-4-6-9/h2-7H,8H2,1H3

SMILES: COc1cnn(Cc2ccccc2)c(=O)c1Cl

Synonyms:

• 3(2H)-pyridazinone, 4-chloro-5-methoxy-2-(phenylmethyl)-
• 2-Benzyl-4-chloro-5-methoxypyridazin-3(2H)-one

2-benzyl-4-chloro-5-methoxypyridazin-3(2H)-one

CAS: 40890-47-9

2-benzyl-4-chloro-5-methoxypyridazin-3(2H)-one

Purity: ≥95%

Molecular weight: 250.68g/mol

Ref: 54-OR27762