CAS 40899-37-4
:4-bromo-3-methylpyridine hydrochloride
Description:
4-Bromo-3-methylpyridine hydrochloride is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position and a methyl group at the 3-position of the pyridine ring contributes to its unique chemical properties. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the hydrochloride salt form, which enhances its solubility compared to the free base. It is often used in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The compound exhibits basic properties due to the nitrogen atom in the pyridine ring, allowing it to participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Safety data indicates that it should be handled with care, as it may pose health risks if inhaled or ingested, and appropriate safety measures should be taken during its use in laboratory settings.
Formula:C6H7BrClN
InChI:InChI=1/C6H6BrN.ClH/c1-5-4-8-3-2-6(5)7;/h2-4H,1H3;1H
SMILES:Cc1cnccc1Br.Cl
Synonyms:- 4-Bromo-3-methylpyridine hydrochloride (1:1)
- 4-Bromo-3-picoline HCl
- Pyridine, 4-Bromo-3-Methyl-, Hydrochloride (1:1)
- 4-Bromo-3-methylpyridine HCl salt
- 4-Bromo-3-methyl pyridine hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Bromo-3-methylpyridine, HCl
CAS:Formula:C6H7BrClNPurity:95%Color and Shape:SolidMolecular weight:208.4835Ref: IN-DA0033XU
500gTo inquire100mg25.00€250mg37.00€1g51.00€5g77.00€10g123.00€25g170.00€50g307.00€100g601.00€4-Bromo-3-methylpyridine hydrochloride
CAS:4-Bromo-3-methylpyridine hydrochlorideFormula:C6H6BrN·ClHPurity:95%Color and Shape: off-white to light yellow solidMolecular weight:208.48348g/mol4-Bromo-3-methylpyridine hydrochloride
CAS:Controlled ProductApplications 4-Bromo-3-methylpyridine, HCl
Formula:C6H6BrN·HClColor and Shape:NeatMolecular weight:208.484-Bromo-3-methylpyridine hydrochloride
CAS:Formula:C6H7BrClNPurity:95%Color and Shape:SolidMolecular weight:208.48



