CAS 40899-71-6
:1-(Phenylsulfonyl)-indole
Description:
1-(Phenylsulfonyl)-indole is an organic compound characterized by the presence of an indole ring, which is a bicyclic structure consisting of a benzene fused to a pyrrole. The compound features a phenylsulfonyl group, which is a sulfonyl functional group (–SO2) attached to a phenyl ring. This sulfonyl moiety enhances the compound's reactivity and solubility in various solvents. The presence of both the indole and sulfonyl groups contributes to its potential biological activity, making it of interest in medicinal chemistry. Typically, compounds like 1-(Phenylsulfonyl)-indole may exhibit properties such as being a potential inhibitor in various biochemical pathways or serving as a scaffold for drug development. Its molecular structure allows for various interactions with biological targets, which can be explored in pharmacological studies. Additionally, the compound's stability and reactivity can be influenced by the substituents on the indole and phenyl rings, making it a versatile candidate for further chemical modifications.
Formula:C14H11NO2S
InChI:InChI=1/C14H11NO2S/c16-18(17,13-7-2-1-3-8-13)15-11-10-12-6-4-5-9-14(12)15/h1-11H
SMILES:c1ccc(cc1)S(=O)(=O)n1ccc2ccccc12
Synonyms:- 1-(Phenylsulfonyl)-1H-indole
- 1H-Indole, 1-(phenylsulfonyl)-
- 1-(Benzenesulfonyl)-1H-indole
- 1-(Phenylsulfonyl)Indole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-(Phenylsulfonyl)indole, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C14H11NO2SPurity:98%Color and Shape:Powder or fused solid, White to cream to pale brownMolecular weight:257.311-(Phenylsulfonyl)-1H-indole
CAS:Formula:C14H11NO2SPurity:97%Color and Shape:SolidMolecular weight:257.30761-(Phenylsulfonyl)-1H-indole
CAS:Formula:C14H11NO2SPurity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:257.311-(Phenylsulfonyl)-1H-indole
CAS:1-Phenylsulfonyl-1H-indole is a synthetic, non-naturally occurring compound that belongs to the class of indole alkaloids. It is an asymmetrical molecule with a dihedral angle of 12.2° and a molecular weight of 226.11 g/mol. The compound has two benzyl groups that are attached to the phenylsulfonyl group at C4 and C5 positions, which are both hydrogen bonded to the indole group at C3 position. 1-Phenylsulfonyl-1H-indole is used as a starting material in organic reactions. It can be reacted with organolithium reagents to form sulfonamides or with Friedel–Crafts reaction to produce ketones.Formula:C14H11NO2SPurity:Min. 95%Molecular weight:257.31 g/mol





