CAS 4090-18-0
:(13alpha)-4-hydroxy-3,6-dimethoxy-17-methyl-5,6,8,14-tetradehydromorphinan-7-one
Description:
The chemical substance known as (13alpha)-4-hydroxy-3,6-dimethoxy-17-methyl-5,6,8,14-tetradehydromorphinan-7-one, with the CAS number 4090-18-0, is a member of the morphinan class of compounds, which are characterized by their complex polycyclic structure. This particular compound features multiple functional groups, including hydroxyl (-OH) and methoxy (-OCH3) groups, which contribute to its chemical reactivity and potential biological activity. The presence of the tetradehydro configuration indicates that it has undergone specific hydrogen atom eliminations, affecting its stereochemistry and possibly its pharmacological properties. Morphinans are often studied for their analgesic and psychoactive effects, and this compound may exhibit similar properties. Its structural modifications can influence its interaction with opioid receptors, making it of interest in medicinal chemistry and pharmacology. However, detailed studies would be necessary to fully elucidate its biological effects and therapeutic potential.
Formula:C19H21NO4
InChI:InChI=1/C19H21NO4/c1-20-7-6-19-10-16(24-3)14(21)9-12(19)13(20)8-11-4-5-15(23-2)18(22)17(11)19/h4-5,9-10,13,22H,6-8H2,1-3H3/t13-,19-/m0/s1
SMILES:CN1CC[C@]23C=C(C(=O)C=C2[C@@H]1Cc1ccc(c(c31)O)OC)OC
Synonyms:- Sinoacutine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(-)-Salutaridine
CAS:(-)-Salutaridine is a natural product isolated from Stephania epigaea Lo.Sinoacutine has protective effects against hydrogen peroxide-induced cell injury.Formula:C19H21NO4Purity:99.31% - 99.88%Color and Shape:SolidMolecular weight:327.37Sinoacutine
CAS:Controlled ProductSinoacutine is a protopine analogue that has been shown to decrease the proliferation of cervical cancer cells by binding to toll-like receptors on the surface of these cells. The molecule also inhibits DNA replication and protein synthesis, which are essential for tumor cell growth. Sinoacutine also inhibits an enzyme called polymerase chain (PCR) and is an antimicrobial agent. It is a competitive inhibitor of mammalian tissue PCRs, but not bacterial PCRs. Sinoacutine binds to the active site of this enzyme, blocking its function and preventing the synthesis of DNA in the host cell.Purity:Min. 95%Color and Shape:White/Off-White Solid





