CAS 4090-55-5
:1,3,2-Dioxaphosphorinane, 2-chloro-5,5-dimethyl-, 2-oxide
Description:
1,3,2-Dioxaphosphorinane, 2-chloro-5,5-dimethyl-, 2-oxide, commonly referred to by its CAS number 4090-55-5, is a chemical compound characterized by its unique cyclic structure that incorporates both phosphorus and oxygen atoms. This compound features a dioxaphosphorinane ring, which is a five-membered heterocyclic structure containing two oxygen atoms and one phosphorus atom. The presence of a chlorine substituent at the 2-position and dimethyl groups at the 5-position contributes to its reactivity and potential applications in various chemical processes. As an oxide, it may exhibit properties typical of phosphorus oxides, including potential use as a reagent in organic synthesis or as a catalyst. The compound's stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups. Safety data should be consulted for handling and storage, as compounds containing phosphorus and chlorine can pose specific hazards. Overall, this substance is of interest in both academic research and industrial applications, particularly in the fields of organophosphorus chemistry and materials science.
Formula:C5H10ClO3P
InChI:InChI=1S/C5H10ClO3P/c1-5(2)3-8-10(6,7)9-4-5/h3-4H2,1-2H3
InChI key:InChIKey=VZMUCIBBVMLEKC-UHFFFAOYSA-N
SMILES:CC1(C)COP(Cl)(=O)OC1
Synonyms:- 1,3,2-Dioxaphosphorinane, 2-chloro-5,5-dimethyl-, 2-oxide
- 1,3-Propanediol, 2,2-dimethyl-, cyclic phosphorochloridate
- 2,2-Dimethyltrimethylene phosphorochloridate
- 2-Chloro-2-oxo-5,5-dimethyl-1,3,2-dioxaphosphorinane
- 2-Chloro-5,5-Dimethyl-1,3,2-Dioxaphosphinane 2-Oxide
- 2-Chloro-5,5-dimethyl-1,3,2-dioxaphosphorinan-2-one
- 2-Chloro-5,5-dimethyl-1,3,2λ5-dioxaphosphinan-2-one
- 2-Chloro-5,5-dimethyl-2-oxo-1,3,2-dioxaphosphorinane
- 2-Chloro-5,5-dimethyl-2-oxodioxaphosphorinane
- 5,5-Dimethyl-2-chloro-2-oxo-1,3,2-dioxaphosphorinane
- Cyclic 2,2-dimethyl-1,3-propanediol phosphoryl chloride
- Cyclic 2,2-dimethyltrimethylene phosphorochloridate
- Dmocp
- Phosphorochloridic acid, cyclic (2,2-dimethyltrimethylene) ester
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Chloro-5,5-dimethyl-1,3,2-dioxaphosphorinane 2-oxide
CAS:Formula:C5H10ClO3PPurity:97%Color and Shape:SolidMolecular weight:184.55792-Chloro-5,5-dimethyl-1,3,2-dioxaphosphorinane 2-oxide
CAS:2-Chloro-5,5-dimethyl-1,3,2-dioxaphosphorinane 2-oxideFormula:C5H10ClO3PPurity:98%Color and Shape: white crystalsMolecular weight:184.56g/mol2-Chloro-5,5-dimethyl-1,3,2-dioxaphosphorinane 2-oxide
CAS:Formula:C5H10ClO3PPurity:97%Color and Shape:SolidMolecular weight:184.562-Chloro-5,5-dimethyl-1,3,2-dioxaphosphorinane 2-oxide
CAS:Controlled ProductFormula:C5H10ClO3PColor and Shape:NeatMolecular weight:184.562-Chloro-5,5-dimethyl-1,3,2-dioxaphosphorinane 2-oxide
CAS:2-Chloro-5,5-dimethyl-1,3,2-dioxaphosphorinane 2-oxide is a molecule with two chlorine atoms and one oxygen atom. The phosphoryl group has two phosphoranes that are linked by a pyrophosphate bond. The molecule also has a nucleophilic hydrogen chloride and an oxygen carbon double bond. The conformation of the molecule can be determined by the three cyclic groups on the left side of the molecule. This compound is used as an intermediate in organic synthesis for the preparation of other molecules. This reinvestigation shows that this compound bonds to a nucleophilic atom or group to form a new carbon chain and an oxo bridge.Formula:C5H10ClO3PPurity:Min. 95%Molecular weight:184.56 g/mol




