CAS 40908-35-8

N-cbz-leu-tyr

Description:

N-Cbz-leu-tyr, also known as N-carbobenzyloxy-leucine-tyrosine, is a synthetic compound commonly used in peptide synthesis and research. It features a carbobenzyloxy (Cbz) protecting group on the amino group of leucine, which is an essential amino acid, and is linked to tyrosine, another aromatic amino acid. This compound is characterized by its stability under various conditions, making it suitable for use in organic synthesis. The presence of the Cbz group provides protection against unwanted reactions during peptide coupling processes. N-Cbz-leu-tyr is typically a white to off-white solid and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and methanol, but less soluble in water. Its molecular structure allows for specific interactions in biological systems, making it valuable in the study of peptide behavior and function. As with many synthetic peptides, handling should be done with care, following appropriate safety protocols to avoid exposure.

Formula: C₂₃H₂₈N₂O₆

InChI: InChI=1/C23H28N2O6/c1-15(2)12-19(25-23(30)31-14-17-6-4-3-5-7-17)21(27)24-20(22(28)29)13-16-8-10-18(26)11-9-16/h3-11,15,19-20,26H,12-14H2,1-2H3,(H,24,27)(H,25,30)(H,28,29)

SMILES: CC(C)CC(C(=NC(Cc1ccc(cc1)O)C(=O)O)O)N=C(O)OCc1ccccc1

Synonyms:

• Z-Leu-Tyr-OH
• N-[(benzyloxy)carbonyl]leucyltyrosine

Z-Leu-Tyr-OH

CAS: 40908-35-8

The enzyme z-leu-tyr-OH is a peptidyl acid phosphatase that hydrolyzes the phosphate group from peptides. It is activated at acidic ph, and has been shown to hydrolyze the residue of metal ions such as Zn2+, Cu2+ and Hg2+. The enzyme is expressed by tissues such as the pancreas, and has been shown to be involved in the biochemical processes of hyaluronate degradation.

Formula: C₂₃H₂₈N₂O₆

Purity: Min. 95%

Molecular weight: 428.48 g/mol

Ref: 3D-FL111499