CymitQuimica logo

CAS 40915-37-5

:

3,4-Dihydro-2H-pyran-5-carboxylic acid

Description:
3,4-Dihydro-2H-pyran-5-carboxylic acid is a cyclic compound characterized by a six-membered ring structure containing both oxygen and carbon atoms. This compound features a carboxylic acid functional group, which imparts acidic properties and enhances its reactivity in various chemical reactions. The presence of the dihydropyran ring contributes to its stability and influences its solubility in polar solvents. Typically, compounds like 3,4-dihydro-2H-pyran-5-carboxylic acid are of interest in organic synthesis and medicinal chemistry due to their potential applications in the development of pharmaceuticals and agrochemicals. The compound may exhibit biological activity, making it a candidate for further research in drug discovery. Its molecular structure allows for various functionalization possibilities, which can lead to the synthesis of derivatives with enhanced properties. Overall, this compound is a valuable building block in organic chemistry, with implications in both industrial and academic research settings.
Formula:C6H8O3
InChI:InChI=1S/C6H8O3/c7-6(8)5-2-1-3-9-4-5/h4H,1-3H2,(H,7,8)
InChI key:InChIKey=MIBCYYGVLHFYSD-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1CCCOC1
Synonyms:
  • 2,3-Dihydro-pyran-5-carboxylic acid
  • 3,4-Dihydro-2H-pyran-5-carboxylic acid
  • 2H-Pyran-5-carboxylic acid, 3,4-dihydro-
Found 4 products.