CAS 40925-28-8
:Ribavirin monophosphate
Description:
Ribavirin monophosphate is a nucleotide analog derived from ribavirin, which is an antiviral medication primarily used to treat viral infections such as hepatitis C and respiratory syncytial virus (RSV). As a monophosphate derivative, it plays a crucial role in the mechanism of action of ribavirin, particularly in inhibiting viral RNA synthesis. The substance is characterized by its ability to interfere with the replication of RNA viruses by mimicking the natural nucleotides, leading to the incorporation of the analog into viral RNA, which ultimately results in defective viral genomes. Ribavirin monophosphate is typically soluble in water and exhibits stability under physiological conditions. Its pharmacological properties are influenced by its structure, which includes a ribose sugar, a phosphate group, and a modified base that contributes to its antiviral activity. The compound is of interest in research for its potential applications in treating various viral infections and is studied for its biochemical interactions within cellular systems.
Formula:C8H13N4O8P
InChI:InChI=1S/C8H13N4O8P/c9-6(15)7-10-2-12(11-7)8-5(14)4(13)3(20-8)1-19-21(16,17)18/h2-5,8,13-14H,1H2,(H2,9,15)(H2,16,17,18)/t3-,4-,5-,8-/m1/s1
InChI key:InChIKey=SDWIOXKHTFOULX-AFCXAGJDSA-N
SMILES:O[C@H]1[C@@H](O[C@H](COP(=O)(O)O)[C@H]1O)N2N=C(C(N)=O)N=C2
Synonyms:- 1-(5-O-Phosphono-β-<span class="text-smallcaps">D</span>-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide
- 1H-1,2,4-Triazole-3-carboxamide, 1-(5-O-phosphono-β-<span class="text-smallcaps">D</span>-ribofuranosyl)-
- 1H-1,2,4-triazole-3-carboxamide, 1-(5-O-phosphono-beta-D-ribofuranosyl)-
- NSC 274937
- Ribavirin 5′-monophosphate
- Ribavirin 5′-phosphate
- Ribavirin monophosphate
- Virazole 5′-phosphate
- 1H-1,2,4-Triazole-3-carboxamide, 1-(5-O-phosphono-β-D-ribofuranosyl)-
- 1-(5-O-Phosphono-β-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ribavirin 5'-monophosphate sodium salt
CAS:Ribavirin is an antiviral drug that is used in the treatment of a number of viral infections, including chronic hepatitis C, respiratory syncytial virus, and influenza. Ribavirin inhibits the synthesis of RNA by interfering with ribonucleotide reductase. Ribavirin 5'-monophosphate sodium salt (RPMPS) is a prodrug that is hydrolyzed to form ribavirin 5'-triphosphate (RTP). This active form inhibits the polymerase chain reaction by binding to DNA polymerase. Ribavirin has been shown to be effective against cell lines resistant to other antiviral drugs such as zirconium oxide. RPMPS has also been shown to be an inhibitor of structural analysis and energy metabolism in erythrocytes.Formula:C8H13N4O8P·xNaPurity:Min. 95%Color and Shape:PowderMolecular weight:324.18 g/mol


