CAS 409344-71-4

[4-(2,6-dioxo-1-propyl-3,7-dihydropurin-8-yl)phenyl]sulfonyloxypotassium

Description:

The chemical substance known as [4-(2,6-dioxo-1-propyl-3,7-dihydropurin-8-yl)phenyl]sulfonyloxypotassium, with the CAS number 409344-71-4, is a potassium salt characterized by its complex structure that includes a sulfonyl group and a purine derivative. This compound typically exhibits properties associated with both organic and inorganic chemistry, including solubility in polar solvents due to the presence of the sulfonate group. Its purine moiety suggests potential biological activity, possibly influencing nucleic acid interactions or enzyme inhibition. The presence of the phenyl group may contribute to its stability and reactivity, while the dioxo and propyl substituents can affect its pharmacokinetic properties. As a potassium salt, it is likely to dissociate in solution, releasing potassium ions, which can play a role in various biochemical processes. Overall, this compound may have applications in medicinal chemistry or biochemistry, although specific biological activities would require further investigation through empirical studies.

Formula: C₁₄H₁₃KN₄O₅S

InChI: InChI=1/C14H14N4O5S.K/c1-2-7-18-13(19)10-12(17-14(18)20)16-11(15-10)8-3-5-9(6-4-8)24(21,22)23;/h3-6H,2,7H2,1H3,(H,15,16)(H,17,20)(H,21,22,23);/q;+1/p-1/rC14H13KN4O5S/c1-2-7-19-13(20)10-12(18-14(19)21)17-11(16-10)8-3-5-9(6-4-8)25(22,23)24-15/h3-6H,2,7H2,1H3,(H,16,17)(H,18,21)

SMILES: CCCn1c(=O)c2c(nc(c3ccc(cc3)S(=O)(=O)O)[nH]2)nc1O.K

PSB 1115 potassium salt hydrate

CAS: 409344-71-4

Formula: C₁₄H₁₃KN₄O₅S·xH₂O

Molecular weight: 388.44 (anhydrous)

Ref: 7W-GL3732

PSB 1115 potassium

CAS: 409344-71-4

PSB 1115 potassium is an antagonist of the adenosine receptor. It binds to adenosine a2b receptors and blocks the binding of adenosine to its receptor, thereby preventing the effects of adenosine on blood vessels. PSB 1115 potassium has been shown to be therapeutically effective in atherosclerosis, which may be due to its ability to inhibit the production of inflammatory cytokines such as IL-6 and TNF-α.

Purity: Min. 95%

Ref: 3D-BP178450

PSB 1115

Controlled Product

CAS: 409344-71-4

Formula: C₁₄H₁₄N₄O₅S•K

Color and Shape: Neat

Ref: TR-P839253

PSB-1115 potassium salt

CAS: 409344-71-4

PSB-1115 potassium salt, a selective A2B Adenosine Receptor antagonist, inhibits the 2,4,6-trinitrobenzenesulfonic acid (TNBS)-induced contraction inhibition of acetylcholine (ACh) [1].

Formula: C₁₄H₁₃KN₄O₅S

Color and Shape: Solid

Molecular weight: 388.44

Ref: TM-T84741