CAS 409353-81-7

1-(1,3-benzodioxol-5-yl)-2,5-dimethyl-1H-pyrrole-3-carbaldehyde

Description:

1-(1,3-benzodioxol-5-yl)-2,5-dimethyl-1H-pyrrole-3-carbaldehyde is a chemical compound characterized by its unique structure, which includes a pyrrole ring substituted with a benzodioxole moiety and an aldehyde functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the aldehyde group. The benzodioxole fragment contributes to its aromatic character and may influence its solubility and interaction with biological systems. The presence of the dimethyl groups on the pyrrole ring can affect the compound's electronic properties and steric hindrance, potentially impacting its reactivity and binding affinity in various chemical reactions. This compound may be of interest in organic synthesis, medicinal chemistry, or materials science due to its structural features, which could lend themselves to applications in drug development or as a precursor for more complex molecules. As with many organic compounds, its behavior in different solvents and under various conditions would be essential for understanding its full range of characteristics.

Formula: C₁₄H₁₃NO₃

InChI: InChI=1/C14H13NO3/c1-9-5-11(7-16)10(2)15(9)12-3-4-13-14(6-12)18-8-17-13/h3-7H,8H2,1-2H3

SMILES: Cc1cc(C=O)c(C)n1c1ccc2c(c1)OCO2

Synonyms:

• 1H-Pyrrole-3-carboxaldehyde, 1-(1,3-benzodioxol-5-yl)-2,5-dimethyl-

1-Benzo[1,3]dioxol-5-yl-2,5-dimethyl-1H-pyrrole-3-carbaldehyde

CAS: 409353-81-7

Versatile small molecule scaffold

Formula: C₁₄H₁₃NO₃

Purity: Min. 95%

Molecular weight: 243.26 g/mol

Ref: 3D-JRA35381