CAS 40951-21-1
:disodium 2-hydroxypentanedioate
Description:
Disodium 2-hydroxypentanedioate, also known as disodium malate, is a sodium salt of malic acid, characterized by its two sodium ions and a hydroxyl group attached to a five-carbon dicarboxylic acid structure. This compound typically appears as a white crystalline powder and is soluble in water, making it useful in various applications, including food and pharmaceutical industries. It serves as a buffering agent and a flavor enhancer due to its mild acidity and ability to stabilize pH levels. The presence of two carboxyl groups contributes to its chelating properties, allowing it to bind metal ions, which can be beneficial in certain biochemical processes. Additionally, disodium 2-hydroxypentanedioate is recognized for its role in metabolic pathways, particularly in energy production and the Krebs cycle. Safety data indicates that it is generally regarded as safe for consumption, although, like any chemical, it should be handled with care to avoid excessive exposure.
Formula:C5H6Na2O5
InChI:InChI=1/C5H8O5.2Na/c6-3(5(9)10)1-2-4(7)8;;/h3,6H,1-2H2,(H,7,8)(H,9,10);;/q;2*+1/p-2
SMILES:C(CC(=O)O)C(C(=O)O)O.[Na].[Na]
Synonyms:- Pentanedioic Acid, 2-Hydroxy-, Sodium Salt (1:2)
- Disodium 2-hydroxypentanedioate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Pentanedioic acid,2-hydroxy-, sodium salt (1:2)
CAS:Formula:C5H6Na2O5Purity:95%Color and Shape:SolidMolecular weight:192.0777Disodium 2-Hydroxypentanedioate
CAS:Disodium 2-HydroxypentanedioatePurity:95%Molecular weight:192.08g/molDL-α-Hydroxyglutaric acid disodium salt
CAS:DL-α-Hydroxyglutaric acid disodium saltPurity:≥98%Molecular weight:192.08g/molDL-α-Hydroxyglutaric acid disodium salt
CAS:<p>DL-α-Hydroxyglutaric acid disodium salt (disodium 2-hydroxypentanedioate) is an α -hydroxyacid formed from the hydrolysis of (R) -5-oxy-2-tetrahydrofuran</p>Formula:C5H6Na2O5Purity:≥98%Color and Shape:SolidMolecular weight:192.082-Hydroxyglutaric Acid-d3 Disodium Salt
CAS:Controlled Product<p>Applications Labelled 2-Hydroxyglutaric acid disodium salt (H942575). 2-Hydroxyglutaric acid is a potential inhibitor of glutamate carboxypeptidase.<br>References Wolcott, T.G., et al.: Biochem. Biophys. Res. Commun., 57, 709 (1974), Knowles, P.F., et al.: Eur. J. Biochem., 114, 139 (1981),<br></p>Formula:C5H3D3Na2O5Color and Shape:White To Off-WhiteMolecular weight:195.12-Hydroxyglutaric Acid Disodium
CAS:Controlled Product<p>Applications 2-Hydroxyglutaric acid is a potential inhibitor of glutamate carboxypeptidase.<br>References Wolcott, T.G., et al.: Biochem. Biophys. Res. Commun., 57, 709 (1974), Knowles, P.F., et al.: Eur. J. Biochem., 114, 139 (1981),<br></p>Formula:C5H6O5·2NaColor and Shape:NeatMolecular weight:192.08




