CAS 40951-39-1
:4-Aminopiperidine-4-carboxylic acid
Description:
4-Aminopiperidine-4-carboxylic acid is an organic compound characterized by its piperidine ring structure, which features an amino group and a carboxylic acid functional group. This compound is typically a white to off-white solid and is soluble in water due to the presence of the carboxylic acid group, which can ionize in aqueous solutions. The amino group contributes to its basicity, allowing it to participate in various chemical reactions, including those typical of amines and carboxylic acids. It is often used in pharmaceutical research and synthesis, particularly in the development of biologically active compounds. The presence of both the amino and carboxylic acid functionalities makes it a versatile building block in organic synthesis, enabling the formation of various derivatives. Additionally, its structural features may influence its biological activity, making it of interest in medicinal chemistry. As with many chemical substances, proper handling and safety precautions should be observed due to potential reactivity and toxicity.
Formula:C6H13N2O2
InChI:InChI=1/C6H12N2O2/c7-6(5(9)10)1-3-8-4-2-6/h8H,1-4,7H2,(H,9,10)/p+1
Synonyms:- 4-Amino-4-piperidinecarboxylic acid
- 4-Ammoniopiperidinium-4-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Aminopiperidine-4-carboxylic acid
CAS:Formula:C6H12N2O2Purity:98%Color and Shape:SolidMolecular weight:144.17174-Aminopiperidine-4-carboxylic acid
CAS:<p>4-Aminopiperidine-4-carboxylic acid</p>Purity:95%Color and Shape:SolidMolecular weight:144.17g/mol4-Aminopiperidine-4-carboxylic Acid
CAS:Controlled Product<p>Applications A cyclic α,α-disubstituted amino acid for preparation of water-soluble highly helical peptides.<br>References Wysong, C.L., et al.: J. Org. Chem., 61, 7650 (1996)<br></p>Formula:C6H12N2O2Color and Shape:NeatMolecular weight:144.174-Aminopiperidine-4-carboxylic acid
CAS:Formula:C6H12N2O2Purity:95.0%Color and Shape:SolidMolecular weight:144.174




