CAS 40966-87-8

2-amino-5-chloropyridin-3-ol

Description:

2-Amino-5-chloropyridin-3-ol is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an amino group (-NH2) and a hydroxyl group (-OH) attached to the pyridine ring, specifically at the 2 and 3 positions, respectively, while a chlorine atom is substituted at the 5 position. The presence of these functional groups contributes to its polar nature, making it soluble in polar solvents such as water. The compound exhibits basic properties due to the amino group and can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. It may also serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Additionally, the chlorine substituent can influence the compound's reactivity and biological activity. Overall, 2-amino-5-chloropyridin-3-ol is a versatile compound with potential applications in medicinal chemistry and material science.

Formula: C₅H₅ClN₂O

InChI: InChI=1/C5H5ClN2O/c6-3-1-4(9)5(7)8-2-3/h1-2,9H,(H2,7,8)

SMILES: c1c(cnc(c1O)N)Cl

Synonyms:

• 3-Pyridinol, 2-Amino-5-Chloro-

2-Amino-5-chloropyridin-3-ol

CAS: 40966-87-8

Formula: C₅H₅ClN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 144.5590

Ref: IN-DA0073QT

2-Amino-5-chloro-3-hydroxypyridine

CAS: 40966-87-8

2-Amino-5-chloro-3-hydroxypyridine

Formula: C₅H₅ClN₂O

Purity: 98%

Color and Shape: brown solid

Molecular weight: 144.56g/mol

Ref: 54-OR345338

2-Amino-5-chloropyridin-3-ol

CAS: 40966-87-8

Formula: C₅H₅ClN₂O

Purity: 98%

Color and Shape: Liquid, No data available.

Molecular weight: 144.56

Ref: 10-F077625