CAS 4097-63-6
:4,6-Dinitroguaiacol
Description:
4,6-Dinitroguaiacol is an organic compound characterized by the presence of two nitro groups (-NO2) attached to the aromatic ring of guaiacol, which is a methoxy-substituted phenol. This compound typically appears as a yellow crystalline solid and is known for its relatively high stability under standard conditions. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic methoxy group. The presence of nitro groups contributes to its reactivity, making it a potential candidate for various chemical reactions, including nitration and reduction processes. 4,6-Dinitroguaiacol is often used in research and industrial applications, particularly in the synthesis of other chemical compounds and as a reagent in analytical chemistry. Additionally, it has been studied for its potential biological activities, including antimicrobial properties. However, handling this compound requires caution due to its toxicological profile, as nitro compounds can pose health risks if not managed properly.
Formula:C7H6N2O6
InChI:InChI=1S/C7H6N2O6/c1-15-6-3-4(8(11)12)2-5(7(6)10)9(13)14/h2-3,10H,1H3
InChI key:InChIKey=ASODNZCPFZQUKR-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(O)C(OC)=CC(N(=O)=O)=C1
Synonyms:- 4,6-Dinitroguaiacol
- Guaiacol, 4,6-dinitro-
- Phenol, 2-Methoxy-4,6-Dinitro-
- 2-Methoxy-4,6-dinitrophenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
