CAS 40972-42-7

3,6-Dichloroimidazo[1,2-b]pyridazine

Description:

3,6-Dichloroimidazo[1,2-b]pyridazine is a heterocyclic compound characterized by its fused imidazole and pyridazine rings, which incorporate two chlorine atoms at the 3 and 6 positions. This compound typically exhibits a pale yellow to off-white crystalline appearance and is soluble in organic solvents. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmaceutical research. The presence of chlorine substituents can enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. 3,6-Dichloroimidazo[1,2-b]pyridazine may also exhibit properties such as moderate stability under standard conditions, but its reactivity can vary depending on the surrounding environment and functional groups present. As with many heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Safety data should be consulted for handling and usage, as halogenated compounds can pose health risks. Overall, this compound represents a significant class of chemicals with potential applications in drug development and other fields.

Formula: C₆H₃Cl₂N₃

InChI: InChI=1/C6H3Cl2N3/c7-4-1-2-6-9-3-5(8)11(6)10-4/h1-3H

SMILES: c1cc2ncc(Cl)n2nc1Cl

Synonyms:

• Imidazo[1,2-B]Pyridazine, 3,6-Dichloro-

3,6-Dichloroimidazo[1,2-b]pyridazine

CAS: 40972-42-7

Formula: C₆H₃Cl₂N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 188.0141

Ref: IN-DA00CLCV

3,6-Dichloroimidazo[1,2-b]pyridazine

CAS: 40972-42-7

3,6-Dichloroimidazo[1,2-b]pyridazine

Purity: 98%

Molecular weight: 188.01g/mol

Ref: 54-OR94208

3,6-Dichloroimidazo[1,2-b]pyridazine

CAS: 40972-42-7

Formula: C₆H₃Cl₂N₃

Purity: 98%

Molecular weight: 188.01

Ref: 10-F321161