CymitQuimica logo

CAS 40983-95-7

:

(6S,8S,8aS)-6,7-dibenzyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol

Description:
The chemical substance with the name "(6S,8S,8aS)-6,7-dibenzyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol" and CAS number "40983-95-7" is a complex organic compound characterized by its unique bicyclic structure, which includes a pyran and dioxin moiety. This compound features multiple functional groups, including two benzyloxy groups and a phenyl group, contributing to its potential reactivity and solubility properties. The stereochemistry indicated by the (6S,8S,8aS) configuration suggests specific spatial arrangements of atoms, which can significantly influence the compound's biological activity and interactions. Such compounds are often studied for their potential applications in pharmaceuticals, particularly due to their structural complexity and the presence of multiple aromatic systems, which can enhance their binding affinity to biological targets. Additionally, the presence of hydroxyl groups may impart polar characteristics, affecting solubility in various solvents. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical properties, making it a subject of interest in organic and medicinal chemistry.
Formula:C27H28O6
InChI:InChI=1/C27H28O6/c28-23-24-22(18-31-26(33-24)21-14-8-3-9-15-21)32-27(30-17-20-12-6-2-7-13-20)25(23)29-16-19-10-4-1-5-11-19/h1-15,22-28H,16-18H2/t22?,23-,24+,25?,26?,27-/m0/s1
Sort by

Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
  • 1,2-Di-O-benzyl-4,6-O-benzylidene-a-D-mannopyranoside

    CAS:
    <p>1,2-Di-O-benzyl-4,6-O-benzylidene-a-D-mannopyranoside is a custom synthesis that belongs to the class of polysaccharides. It is a synthetic modification of D-mannose. The 1,2 position on the glucose moiety has been fluorinated and the 6 position on the mannose moiety has been methylated. This sugar is a monosaccharide with a molecular weight of 587. The glycosylation pattern includes saccharide units linked by glycosidic bonds between the 1 and 2 positions on adjacent sugars in linear or branched chains. This product can be used as an intermediate for other syntheses or as a pharmaceutical drug.</p>
    Formula:C27H28O6
    Purity:Min. 95%
    Molecular weight:448.51 g/mol

    Ref: 3D-MD04585

    ne
    To inquire