CAS 4099-85-8: Methyl 2,3-O-(1-methylethylidene)-β-D-ribofuranoside
Description:Methyl 2,3-O-(1-methylethylidene)-β-D-ribofuranoside, with the CAS number 4099-85-8, is a glycoside derivative of ribofuranose. This compound features a methyl group attached to the anomeric carbon, which enhances its stability and solubility in organic solvents. The presence of the 1-methylethylidene group contributes to its unique structural characteristics, influencing its reactivity and potential applications in organic synthesis and biochemistry. Typically, such compounds are utilized in the study of carbohydrate chemistry and can serve as intermediates in the synthesis of more complex molecules, including nucleosides and nucleotides. The compound is generally stable under standard laboratory conditions but may be sensitive to hydrolysis in the presence of strong acids or bases. Its solubility in polar solvents makes it suitable for various chemical reactions and analytical techniques. Overall, Methyl 2,3-O-(1-methylethylidene)-β-D-ribofuranoside is an important compound in the field of carbohydrate chemistry, with potential applications in pharmaceuticals and biochemistry.
Formula:C9H16O5
InChI:InChI=1S/C9H16O5/c1-9(2)13-6-5(4-10)12-8(11-3)7(6)14-9/h5-8,10H,4H2,1-3H3/t5-,6-,7-,8-/m1/s1
InChI key:InChIKey=DXBHDBLZPXQALN-WCTZXXKLSA-N
SMILES:OCC1OC(OC)C2OC(OC12)(C)C
- Synonyms:
- Furo[3,4-d]-1,3-dioxole, β-<span class="text-smallcaps">D</span>-ribofuranoside deriv.
- Methyl 2,3-O-(1-methylethylidene)-β-<span class="text-smallcaps">D</span>-ribofuranoside
- Methyl 2,3-O-isopropylidene-beta-D-ribofuranoside
- Methyl 2,3-O-isopropylidene-β-<span class="text-smallcaps">D</span>-ribofuranoside
- NSC 85191
- Ribofuranoside, methyl 2,3-O-isopropylidene-
- Ribofuranoside, methyl 2,3-O-isopropylidene-, β-<span class="text-smallcaps">D</span>-
- methyl 2,3-O-(1-methylethylidene)-beta-D-ribofuranoside
- methyl 2,3-O-(1-methylethylidene)pentofuranoside
- β-<span class="text-smallcaps">D</span>-Ribofuranoside, methyl 2,3-O-(1-methylethylidene)-
- See more synonyms
- β-D-Ribofuranoside, methyl 2,3-O-(1-methylethylidene)-
- Methyl-2,3-O-isopropylidene-β-D-ribofuranoside
- Methyl 2,3-O-(1-methylethylidene)-β-D-ribofuranoside
- Furo[3,4-d]-1,3-dioxole, β-D-ribofuranoside deriv.
- Ribofuranoside, methyl 2,3-O-isopropylidene-, β-D-
