CAS 4100-13-4
:1,2,3-Thiadiazole-4-carboxylic acid
Description:
1,2,3-Thiadiazole-4-carboxylic acid is a heterocyclic compound characterized by a five-membered ring containing two nitrogen atoms and one sulfur atom, along with a carboxylic acid functional group. This compound exhibits properties typical of thiadiazoles, including potential biological activity and applications in pharmaceuticals and agrochemicals. The presence of the carboxylic acid group contributes to its acidity and solubility in polar solvents, making it useful in various chemical reactions and synthesis processes. Additionally, the thiadiazole ring structure can participate in coordination chemistry, potentially forming complexes with metal ions. The compound's unique structure allows for diverse reactivity, including nucleophilic substitutions and cycloadditions. Its derivatives may exhibit antimicrobial, antifungal, or anti-inflammatory properties, making it of interest in medicinal chemistry. Overall, 1,2,3-Thiadiazole-4-carboxylic acid is a versatile compound with significant potential in various chemical and biological applications.
Formula:C3HN2O2S
InChI:InChI=1/C3H2N2O2S/c6-3(7)2-1-8-5-4-2/h1H,(H,6,7)/p-1
SMILES:c1c(C(=O)[O-])nns1
Synonyms:- 4-Carboxy-1,2,3-thiadiazole
- 1,2,3-Thiadiazole-4-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,2,3-Thiadiazole-4-carboxylic acid, 97%
CAS:It is used as an active pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not chFormula:C3HN2O2SPurity:97%Color and Shape:Powder, Pale brown to brownMolecular weight:129.111,2,3-Thiadiazole-4-carboxylic acid
CAS:Formula:C3H2N2O2SPurity:98%Color and Shape:SolidMolecular weight:130.12521,2,3-Thiadiazole-4-carboxylic acid
CAS:1,2,3-Thiadiazole-4-carboxylic acidPurity:97%Color and Shape:SolidMolecular weight:130.13g/mol[1,2,3]-Thiadiazole-4-carboxylic acid
CAS:Formula:C3H2N2O2SPurity:97%Color and Shape:SolidMolecular weight:130.12



