CAS 4100-18-9

1,2,3-Thiadiazole-4-carboxylic acid, hydrazide

Description:

1,2,3-Thiadiazole-4-carboxylic acid, hydrazide is a heterocyclic compound characterized by the presence of a thiadiazole ring, which incorporates sulfur and nitrogen atoms. This compound features a carboxylic acid functional group and a hydrazide moiety, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid, soluble in polar solvents due to the presence of the carboxylic acid group. The thiadiazole ring is known for its diverse pharmacological properties, including antimicrobial and anti-inflammatory activities. The hydrazide functionality can participate in various chemical reactions, such as hydrazone formation and condensation reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound may exhibit interesting properties in coordination chemistry, potentially forming complexes with transition metals. Overall, 1,2,3-Thiadiazole-4-carboxylic acid, hydrazide is of interest in medicinal chemistry and materials science due to its unique structural features and reactivity.

Formula: C₃H₄N₄OS

InChI: InChI=1S/C3H4N4OS/c4-5-3(8)2-1-9-7-6-2/h1H,4H2,(H,5,8)

InChI key: InChIKey=GBBQRNGEDIWRJI-UHFFFAOYSA-N

SMILES: C(NN)(=O)C1=CSN=N1

Synonyms:

• 1,2,3-Thiadiazole-4-carboxylic acid, hydrazide
• NSC 521677
• 1,2,3-Thiadiazole-4-carbohydrazide

1,2,3-Thiadiazole-4-carbohydrazide

CAS: 4100-18-9

Formula: C₃H₄N₄OS

Color and Shape: Solid

Molecular weight: 144.1551

Ref: IN-DA00D5ZJ

1,2,3-Thiadiazole-4-carbohydrazide

CAS: 4100-18-9

1,2,3-Thiadiazole-4-carbohydrazide

Molecular weight: 144.16g/mol

Ref: 54-OR15247

1,2,3-Thiadiazole-4-carbohydrazide

CAS: 4100-18-9

1,2,3-Thiadiazole-4-carbohydrazide is a heterocyclic compound that can be synthesized by the cleavage of a 1,2,3-thiadiazole. This reaction requires nucleophiles and intramolecular cyclization. Intramolecular cyclization leads to the formation of a five-membered ring with nitrogen as the heteroatom. When this compound reacts with nitrogen nucleophiles, an intramolecular cyclization occurs and recyclization reactions occur. Cyclization reactions are important in organic chemistry because they often lead to the formation of new rings.

Formula: C₃H₄N₄OS

Purity: Min. 95%

Molecular weight: 144.16 g/mol

Ref: 3D-FT136167