CAS 41014-93-1
:(2S)-2-Hydroxypentanoic acid
Description:
(2S)-2-Hydroxypentanoic acid, also known as L-2-hydroxypentanoic acid, is an organic compound characterized by its carboxylic acid functional group and a hydroxyl group attached to the second carbon of a five-carbon chain. This compound is a chiral molecule, existing in two enantiomeric forms, with the (S)-configuration being biologically relevant. It is a colorless to pale yellow liquid or solid, depending on its state, and is soluble in water due to the presence of both the hydroxyl and carboxylic acid groups, which can form hydrogen bonds. The compound is of interest in various fields, including biochemistry and pharmaceuticals, as it may play a role in metabolic pathways and can serve as a building block for the synthesis of more complex molecules. Its properties, such as melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other substances. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C5H10O3
InChI:InChI=1S/C5H10O3/c1-2-3-4(6)5(7)8/h4,6H,2-3H2,1H3,(H,7,8)/t4-/m0/s1
InChI key:InChIKey=JRHWHSJDIILJAT-BYPYZUCNSA-N
SMILES:[C@H](CCC)(C(O)=O)O
Synonyms:- (2S)-2-hydroxypentanoic acid
- (S)-α-Hydroxyvaleric acid
- 2-Hydroxypentanoic Acid
- <span class="text-smallcaps">L</span>-2-Hydroxypentanoic acid
- <span class="text-smallcaps">L</span>-2-Hydroxyvaleric acid
- Pentanoic acid, 2-hydroxy-, (2S)-
- Pentanoic acid, 2-hydroxy-, (S)-
- S-2-Hydroxypentanoic acid
- L-2-Hydroxyvaleric acid
- L-2-Hydroxypentanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(S)-2-hydroxyvaleric acid
CAS:Formula:C5H10O3Purity:97%Color and Shape:SolidMolecular weight:118.1311(S)-2-Hydroxypentanoic acid
CAS:(S)-2-Hydroxypentanoic acid is a malate molecule that is found in the human body. It can be used as an adjuvant therapy for cancer, and has been shown to have a protective effect on the liver. The structural studies of (S)-2-hydroxypentanoic acid have revealed that it is a substrate molecule, which will bind to the enzyme dehydrogenase. This binding leads to the formation of an enzyme-substrate complex, which can be studied using biochemical methods such as profiles and kinetic studies. The binding of (S)-2-hydroxypentanoic acid to dehydrogenase results in an increase in acid-reactive substances and thiobarbituric acid-reactive substances, which are both indicators of oxidative stress. Research has also shown that mutant enzymes can lead to increased levels of (S)-2-hydroxypentanoic acid.Formula:C5H10O3Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:118.13 g/mol(S)-2-Hydroxypentanoic acid
CAS:Formula:C5H10O3Purity:98%Color and Shape:SolidMolecular weight:118.132



