CAS 41018-87-5
:1H-Indole, 2-methyl-5-nitro-3-phenyl-
Description:
1H-Indole, 2-methyl-5-nitro-3-phenyl- (CAS 41018-87-5) is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features a methyl group at the 2-position, a nitro group at the 5-position, and a phenyl group at the 3-position of the indole ring. The presence of the nitro group contributes to its potential reactivity and polarity, while the phenyl group can influence its electronic properties and interactions. Typically, compounds of this nature exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. They may also participate in various chemical reactions, including electrophilic substitutions and reductions. The compound's solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular structure. As with many nitro-substituted compounds, it may exhibit specific toxicological properties, necessitating careful handling and assessment in laboratory settings.
Formula:C15H12N2O2
InChI:InChI=1S/C15H12N2O2/c1-10-15(11-5-3-2-4-6-11)13-9-12(17(18)19)7-8-14(13)16-10/h2-9,16H,1H3
InChI key:InChIKey=HMNKMHCGSIZJDP-UHFFFAOYSA-N
SMILES:CC1=C(C=2C(N1)=CC=C(N(=O)=O)C2)C3=CC=CC=C3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.