CAS 41025-67-6
:3H-Indolium, 3-[2-(2,4-dihydro-2,4-dimethyl-3H-1,2,4-triazol-3-ylidene)hydrazinylidene]-1-methyl-2-phenyl-, chloride (1:1)
Description:
3H-Indolium, 3-[2-(2,4-dihydro-2,4-dimethyl-3H-1,2,4-triazol-3-ylidene)hydrazinylidene]-1-methyl-2-phenyl-, chloride (1:1) is a complex organic compound characterized by its unique indolium structure, which features a positively charged nitrogen atom in a five-membered ring. The compound contains a hydrazinylidene moiety linked to a triazole ring, contributing to its potential biological activity and reactivity. The presence of the chloride ion indicates that it exists as a salt, which can influence its solubility and stability in various solvents. This compound may exhibit interesting properties such as fluorescence or catalytic activity, making it of interest in fields like medicinal chemistry or materials science. Its structural complexity suggests potential applications in drug development or as a precursor for synthesizing other functional materials. However, specific characteristics such as melting point, solubility, and reactivity would require empirical data for precise evaluation.
Formula:C19H19N6·Cl
InChI:InChI=1S/C19H19N6.ClH/c1-23-13-20-25(3)19(23)22-21-17-15-11-7-8-12-16(15)24(2)18(17)14-9-5-4-6-10-14;/h4-13H,1-3H3;1H/q+1;/p-1
InChI key:InChIKey=CNKXSGBFDSBULR-UHFFFAOYSA-M
SMILES:N(N=C1N(C)C=NN1C)=C2C(=[N+](C)C=3C2=CC=CC3)C4=CC=CC=C4.[Cl-]
Synonyms:- (3E)-3-[(2E)-(2,4-dimethyl-2,4-dihydro-3H-1,2,4-triazol-3-ylidene)hydrazinylidene]-1-methyl-2-phenyl-3H-indolium chloride
- 3-(1-Methyl-2-phenylindolyl-3-azo)-2,4-dimethyl-1,2,4-triazolium chloride
- 3H-Indolium, 3-((2,4-dihydro-2,4-dimethyl-3H-1,2,4-triazol-3-ylidene)hydrazono)-1-methyl-2-phenyl-, chloride
- 3H-Indolium, 3-(2-(2,4-dihydro-2,4-dimethyl-3H-1,2,4-triazol-3-ylidene)hydrazinylidene)-1-methyl-2-phenyl-, chloride (1:1)
- Basacryl Yellow 5RL
- Basic Yellow 25
- C.I. Basic Yellow 25
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
C.I.Basic Yellow 25
CAS:C.I. Basic Yellow 25 is a methoxylated, basic dye that belongs to the class of cationic surfactants. It is used as a cross-linking agent in coatings, adhesives, and inks. The chromophore of this compound is hydroxyl group, which reacts with chloride to form an ion pair with a constant charge ratio of 2:1, which can be stabilized by the cross-linking reaction. This compound is reactive and is able to crosslink with other molecules containing carbonyl groups. C.I. Basic Yellow 25 can also act as a polymerization inhibitor for polyvinyl chloride (PVC) resin and has been shown to be effective in preventing the formation of chlorinated dioxins during PVC productionPurity:Min. 95%
