CAS 41029-44-1
:Methanesulfonic acid, trifluoro-, 1-methylethyl ester
Description:
Methanesulfonic acid, trifluoro-, 1-methylethyl ester, also known by its CAS number 41029-44-1, is an organic compound characterized by its ester functional group derived from methanesulfonic acid and 1-methylethanol. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid with a distinctive odor. It is soluble in polar solvents, which is common for many esters, and may have moderate volatility. The trifluoromethyl group contributes to its chemical reactivity and potential applications in various chemical processes, including as a reagent or solvent in organic synthesis. Additionally, the presence of the sulfonic acid moiety may impart unique properties, such as increased acidity compared to typical esters. Safety data indicates that it should be handled with care, as it may be irritating to skin and eyes. Overall, this compound is of interest in both industrial and research settings due to its unique chemical structure and properties.
Formula:C4H7F3O3S
InChI:InChI=1S/C4H7F3O3S/c1-3(2)10-11(8,9)4(5,6)7/h3H,1-2H3
InChI key:NDJBHBQUEAGIOB-UHFFFAOYSA-N
SMILES:CC(C)OS(=O)(=O)C(F)(F)F
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Ref: 4Z-M-132003
Discontinued product

