CAS 41031-50-9
:2-(1-adamantyl)-4-methylphenol
Description:
2-(1-Adamantyl)-4-methylphenol, with the CAS number 41031-50-9, is an organic compound characterized by its unique structure that includes an adamantyl group and a methyl-substituted phenolic ring. This compound typically appears as a solid at room temperature and is known for its hydrophobic properties due to the bulky adamantyl moiety. It exhibits moderate solubility in organic solvents while being less soluble in water. The presence of the hydroxyl (-OH) group in the phenolic structure imparts some degree of acidity, allowing it to participate in hydrogen bonding. This compound is of interest in various fields, including materials science and pharmaceuticals, due to its potential applications as an antioxidant or in the synthesis of more complex organic molecules. Additionally, its unique structural features may contribute to specific biological activities, making it a subject of research in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C17H22O
InChI:InChI=1/C17H22O/c1-11-2-3-16(18)15(4-11)17-8-12-5-13(9-17)7-14(6-12)10-17/h2-4,12-14,18H,5-10H2,1H3
SMILES:Cc1ccc(c(c1)C12CC3CC(CC(C3)C2)C1)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(1-Adamantyl)-4-methylphenol, 99%
CAS:2-(1-Adamantyl)-4-methylphenol, is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU
Formula:C17H22OPurity:99%Color and Shape:White, Crystalline PowderMolecular weight:242.362-(Adamantan-1-yl)-4-methylphenol
CAS:Formula:C17H22OPurity:98%Color and Shape:SolidMolecular weight:242.35602-(1-adamantyl)-4-methylphenol
CAS:2-(1-adamantyl)-4-methylphenolPurity:99%Molecular weight:242.36g/mol


