CAS 41034-83-7
:3-(anthracen-9-yl)propanoic acid
Description:
3-(Anthracen-9-yl)propanoic acid, with the CAS number 41034-83-7, is an organic compound characterized by its structure, which includes an anthracene moiety attached to a propanoic acid group. This compound typically exhibits properties associated with both aromatic hydrocarbons and carboxylic acids. It is likely to be a solid at room temperature, with a relatively high melting point due to the presence of the rigid anthracene structure. The compound is expected to be insoluble in water but soluble in organic solvents, reflecting the hydrophobic nature of the anthracene ring. Its carboxylic acid functional group provides acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, 3-(anthracen-9-yl)propanoic acid may exhibit interesting photophysical properties, making it potentially useful in applications such as organic electronics, fluorescence, and as a building block in organic synthesis. Overall, its unique structure and functional groups contribute to its versatility in chemical applications.
Formula:C17H14O2
InChI:InChI=1/C17H14O2/c18-17(19)10-9-16-14-7-3-1-5-12(14)11-13-6-2-4-8-15(13)16/h1-8,11H,9-10H2,(H,18,19)
SMILES:c1ccc2c(c1)cc1ccccc1c2CCC(=O)O
Synonyms:- 3-(9-Anthryl)propanoic acid
- 9-Anthracenepropanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-(9-Anthryl)propionic acid, 96%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C17H14O2Purity:96%Color and Shape:Cream to yellow, PowderMolecular weight:250.303-(Anthracen-9-yl)propanoic acid
CAS:Formula:C17H14O2Purity:95%Color and Shape:SolidMolecular weight:250.2919
