CAS 4104-47-6

N-Sulfinyl-p-toluenesulfonamide

Description:

N-Sulfinyl-p-toluenesulfonamide, with the CAS number 4104-47-6, is a chemical compound characterized by its sulfinyl functional group attached to a p-toluenesulfonamide moiety. This compound typically appears as a solid and is known for its role in organic synthesis and potential applications in medicinal chemistry. The sulfinyl group contributes to its reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and oxidation processes. The presence of the p-toluenesulfonamide structure imparts properties such as solubility in polar solvents and the ability to form hydrogen bonds, which can influence its biological activity and interactions with other molecules. Additionally, compounds of this nature may exhibit antimicrobial or anti-inflammatory properties, making them of interest in pharmaceutical research. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₇H₇NO₃S₂

InChI: InChI=1/C7H7NO3S2/c1-6-2-4-7(5-3-6)13(10,11)8-12-9/h2-5H,1H3

SMILES: Cc1ccc(cc1)S(=O)(=O)N=S=O

Synonyms:

• 4-methyl-N-sulfinylbenzenesulfonamide
• N-Sulfinyl-4-toluenesulfonamide

N-Sulfinyl-p-toluenesulfonamide

CAS: 4104-47-6

Formula: C₇H₇NO₃S₂

Purity: >70.0%(T)

Color and Shape: White to Orange to Green powder to crystal

Molecular weight: 217.26

Ref: 3B-T1461

N-Sulfinyl-p-toluenesulfonamide

CAS: 4104-47-6

Formula: C₇H₇NO₃S₂

Purity: 70%

Color and Shape: Solid

Molecular weight: 217.2654

Ref: IN-DA003TCL