
CAS 41046-68-8
:4-Iodoresorcinol
Description:
4-Iodoresorcinol is an organic compound characterized by the presence of an iodine atom attached to the para position of a resorcinol structure, which consists of a benzene ring with two hydroxyl (-OH) groups. Its molecular formula is C6H4I(OH)2, indicating that it contains six carbon atoms, four hydrogen atoms, one iodine atom, and two hydroxyl groups. This compound typically appears as a white to light yellow crystalline solid and is soluble in polar solvents such as water and alcohols. 4-Iodoresorcinol is known for its applications in various fields, including organic synthesis and as a reagent in analytical chemistry. It exhibits properties such as being a reducing agent and can participate in various chemical reactions, including electrophilic substitutions. Additionally, due to the presence of the iodine atom, it may exhibit unique biological activities, making it of interest in medicinal chemistry. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C6H5IO2
InChI:InChI=1S/C6H5IO2/c7-5-2-1-4(8)3-6(5)9/h1-3,8-9H
InChI key:InChIKey=DWOPERRUKLPBFG-UHFFFAOYSA-N
SMILES:OC1=C(I)C=CC(O)=C1
Synonyms:- 4-Iodoresorcinol
- 1,3-Benzenediol, 4-iodo-
- Resorcinol, 4-iodo-
- 4-Iodobenzene-1,3-diol
- 4-Iodo-1,3-benzenediol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.