CAS 41049-53-0

1-Phenylcyclopropanamine

Description:

1-Phenylcyclopropanamine, with the CAS number 41049-53-0, is an organic compound characterized by a cyclopropane ring bonded to a phenyl group and an amine functional group. This compound typically exhibits a molecular structure that includes a three-membered cyclopropane ring, which contributes to its unique chemical reactivity and steric properties. The presence of the phenyl group enhances its aromatic characteristics, potentially influencing its interactions with biological systems. As an amine, it can participate in hydrogen bonding and may exhibit basic properties. The compound is of interest in medicinal chemistry and pharmacology due to its potential biological activity, particularly in relation to neurotransmitter systems. Its physical properties, such as solubility and melting point, can vary based on the specific isomer and environmental conditions. Safety and handling considerations are important, as with many amines, due to potential toxicity and reactivity. Overall, 1-Phenylcyclopropanamine serves as a valuable compound for research and development in various chemical and pharmaceutical applications.

Formula: C₉H₁₁N

InChI: InChI=1/C9H11N/c10-9(6-7-9)8-4-2-1-3-5-8/h1-5H,6-7,10H2

SMILES: c1ccc(cc1)C1(CC1)N

Synonyms:

• 1-Phenylcyclopropanamin
• Cyclopropanamine, 1-Phenyl-
• 1-Phenylcyclopropylamine
• 1-Phenyl-Cyclopropylamine

1-Phenyl-cyclopropylamine

CAS: 41049-53-0

Formula: C₉H₁₁N

Purity: 95%

Color and Shape: Liquid

Molecular weight: 133.1903

Ref: IN-DA00BYXH

1-Phenylcyclopropan-1-amine

CAS: 41049-53-0

1-Phenylcyclopropan-1-amine

Formula: C₉H₁₁N

Purity: 98%

Color and Shape: pale yellow liquid

Molecular weight: 133.19034g/mol

Ref: 54-OR302455

1-Phenylcyclopropanamine

CAS: 41049-53-0

Formula: C₉H₁₁N

Purity: 95%

Color and Shape: Solid, Powder

Molecular weight: 133.194

Ref: 10-F049783