CAS 41051-88-1: 3,6-Di(methyl-d3)benzene-1,2,4,5-d4
Description:3,6-Di(methyl-d3)benzene-1,2,4,5-d4, also known by its CAS number 41051-88-1, is a deuterated derivative of di-methylbenzene, specifically a substituted benzene compound. This substance features a benzene ring with two methyl groups that are fully deuterated, meaning that the hydrogen atoms in the methyl groups are replaced with deuterium, a stable isotope of hydrogen. The presence of deuterium enhances the compound's utility in various applications, particularly in NMR spectroscopy, where it serves as a valuable internal standard or tracer due to its distinct spectral properties. The compound is typically used in research settings, particularly in studies involving reaction mechanisms, kinetics, and molecular dynamics. Its physical properties, such as boiling point and solubility, may differ from those of its non-deuterated counterparts due to the isotopic substitution. Overall, 3,6-Di(methyl-d3)benzene-1,2,4,5-d4 is significant in the field of organic chemistry and analytical applications.
Formula:C8D10
InChI:InChI=1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3/i1D3,2D3,3D,4D,5D,6D
InChI key:InChIKey=URLKBWYHVLBVBO-ZGYYUIRESA-N
SMILES:C=1C=C(C=CC1C)C
- Synonyms:
- (2H10)-p-Xylene
- 1,4-bis[(~2~H_3_)methyl](~2~H_4_)benzene
- 3,6-Di(methyl-d<sub>3</sub>)benzene-1,2,4,5-d<sub>4</sub>
- Benzene-1,2,4,5-d<sub>4</sub>, 3,6-di(methyl-d<sub>3</sub>)-
- Perdeuterated 1,4-dimethylbenzene
- Perdeuterated p-xylene
- Perdeuterio-p-xylene
- Perdeutero-p-xylene
- p-Xylene-d<sub>10</sub>
- p-Xylene-d<sub>8</sub>
- See more synonyms
- Benzene-1,2,4,5-d4, 3,6-di(methyl-d3)-
- 3,6-Di(methyl-d3)benzene-1,2,4,5-d4
- p-Xylene-d10
