CAS 410528-02-8: Palovarotene
Description:Palovarotene is a synthetic retinoid, primarily recognized for its role in modulating retinoic acid signaling pathways. It is characterized by its ability to selectively activate retinoic acid receptors, which are crucial in various biological processes, including cell differentiation and proliferation. Palovarotene has garnered attention for its potential therapeutic applications, particularly in the treatment of fibrodysplasia ossificans progressiva (FOP), a rare genetic disorder characterized by abnormal bone growth. The compound is typically administered orally and has been studied for its efficacy in reducing heterotopic ossification. In terms of its chemical structure, palovarotene features a unique arrangement of carbon, hydrogen, and nitrogen atoms, contributing to its biological activity. Its pharmacokinetic properties include absorption, distribution, metabolism, and excretion, which are essential for understanding its therapeutic potential and safety profile. As with many retinoids, palovarotene may exhibit side effects, necessitating careful monitoring during treatment. Overall, its selective action on retinoic acid receptors positions palovarotene as a promising candidate in the field of targeted therapies.
Formula:C27H30N2O2
InChI:InChI=1S/C27H30N2O2/c1-26(2)12-13-27(3,4)24-17-22(18-29-15-5-14-28-29)21(16-23(24)26)11-8-19-6-9-20(10-7-19)25(30)31/h5-11,14-17H,12-13,18H2,1-4H3,(H,30,31)/b11-8+
InChI key:InChIKey=YTFHCXIPDIHOIA-DHZHZOJOSA-N
SMILES:O=C(O)C1=CC=C(C=C1)C=CC=2C=C3C(=CC2CN4N=CC=C4)C(C)(C)CCC3(C)C
- Synonyms:
- 4-[(1E)-2-[5,6,7,8-Tetrahydro-5,5,8,8-tetramethyl-3-(1H-pyrazol-1-ylmethyl)-2-naphthalenyl]ethenyl]benzoic acid
- 4-{(1E)-2-[5,5,8,8-tetramethyl-3-(1H-pyrazol-1-ylmethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]ethenyl}benzoicacid
- Benzoic acid, 4-[(1E)-2-[5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-3-(1H-pyrazol-1-ylmethyl)-2-naphthalenyl]ethenyl]-
- Clm 001
- Ipn 60120
- R 667
- Ro 3300074
- Sohonos
- Palovarotene
