
CAS 410544-95-5
:L 870810
Description:
L 870810, with the CAS number 410544-95-5, is a chemical compound that belongs to the class of small molecules. It is primarily recognized for its role as a selective inhibitor of certain enzymes, particularly those involved in the modulation of biological pathways. This compound has garnered interest in pharmaceutical research due to its potential therapeutic applications, particularly in the treatment of various diseases. L 870810 exhibits specific binding affinity to its target, which can lead to alterations in cellular processes. Its chemical structure includes functional groups that contribute to its biological activity and solubility characteristics. Additionally, studies have indicated that L 870810 may possess favorable pharmacokinetic properties, making it a candidate for further development in drug formulation. As with many chemical substances, safety and toxicity profiles are essential considerations, and ongoing research aims to elucidate its full potential and mechanisms of action in biological systems.
Formula:C20H19FN4O4S
InChI:InChI=1S/C20H19FN4O4S/c21-14-7-5-13(6-8-14)12-23-20(27)17-18(26)16-15(4-3-9-22-16)19(24-17)25-10-1-2-11-30(25,28)29/h3-9,26H,1-2,10-12H2,(H,23,27)
InChI key:InChIKey=DIDKWCOCQJWMDJ-UHFFFAOYSA-N
SMILES:O=S1(=O)N(C=2C3=C(C(O)=C(C(NCC4=CC=C(F)C=C4)=O)N2)N=CC=C3)CCCC1
Synonyms:- N-[(4-Fluorophenyl)methyl]-8-hydroxy-5-(tetrahydro-1,1-dioxido-2H-1,2-thiazin-2-yl)-1,6-naphthyridine-7-carboxamide
- L 870810
- 1,6-Naphthyridine-7-carboxamide, N-[(4-fluorophenyl)methyl]-8-hydroxy-5-(tetrahydro-1,1-dioxido-2H-1,2-thiazin-2-yl)-
- 5-(1,1-Dioxido-1,2-thiazinan-2-yl)-N-(4-fluorobenzyl)-8-hydroxy-1,6-naphthyridine-7-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
L 870810
CAS:L 870810 is a small-molecule inhibitor of HIV-1 integrase with potent antiviral activity in cell culture and good pharmacokinetic properties.Formula:C20H19FN4O4SColor and Shape:SolidMolecular weight:430.45
