CAS 410545-65-2
:1-[2-(methylsulfonyl)phenyl]methanamine
Description:
1-[2-(Methylsulfonyl)phenyl]methanamine, with the CAS number 410545-65-2, is an organic compound characterized by the presence of a methylsulfonyl group attached to a phenyl ring, along with a methanamine functional group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The methylsulfonyl group contributes to its overall polarity and may enhance its reactivity in various chemical reactions. Additionally, the presence of the phenyl ring can impart stability and influence the compound's electronic properties. This substance may be of interest in medicinal chemistry due to its potential biological activity, as compounds with similar structures often exhibit pharmacological properties. Its synthesis and applications could be relevant in the development of pharmaceuticals or agrochemicals, although specific applications would depend on further research into its biological interactions and efficacy.
Formula:C8H11NO2S
InChI:InChI=1/C8H11NO2S/c1-12(10,11)8-5-3-2-4-7(8)6-9/h2-5H,6,9H2,1H3
SMILES:CS(=O)(=O)c1ccccc1CN
Synonyms:- Benzenemethanamine, 2-(methylsulfonyl)-
- 1-[2-(Methylsulfonyl)phenyl]methanamine
- (2-(METHYLSULFONYL)PHENYL)METHANAMINE
- 2-(Methylsulfonyl)-Benzenemethanamine
- 2-Methanesulfonyl-benzylamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2-(METHYLSULFONYL)PHENYL)METHANAMINE
CAS:Formula:C8H11NO2SPurity:95%Color and Shape:SolidMolecular weight:185.24342-(Methylsulfonyl)benzylamine
CAS:2-(Methylsulfonyl)benzylaminePurity:98%Molecular weight:185.24g/mol(2-(Methylsulfonyl)phenyl)methanamine
CAS:Formula:C8H11NO2SPurity:>95%Color and Shape:SolidMolecular weight:185.242-(Methylsulfonyl)benzylamine
CAS:<p>2-(Methylsulfonyl)benzylamine is a transcription factor that has inhibitory activities against the immune system. It inhibits signal transduction, which is involved in the regulation of gene expression. 2-(Methylsulfonyl)benzylamine also inhibits IL-12 production, which is an important cytokine in the regulation of inflammatory responses. This drug has also been shown to have oral bioavailability and can be used to treat asthma and allergic diseases.</p>Formula:C8H11NO2SPurity:Min. 95%Molecular weight:185.24 g/mol



