CAS 41059-79-4

Timosaponin A III

Description:

Timosaponin A III is a saponin compound primarily derived from the plant species Anemarrhena asphodeloides, which is known for its traditional medicinal uses in East Asian herbal medicine. This compound is characterized by its complex glycosidic structure, which typically includes a steroid aglycone linked to sugar moieties. Timosaponin A III exhibits various biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it a subject of interest in pharmacological research. Its mechanism of action often involves modulation of cellular signaling pathways, contributing to its therapeutic effects. Additionally, saponins like Timosaponin A III are known for their ability to form micelles in solution, which can enhance the solubility and bioavailability of other compounds. However, the specific pharmacokinetics and toxicity profiles of Timosaponin A III require further investigation to fully understand its potential applications in medicine. Overall, Timosaponin A III represents a significant compound in the study of natural products and their therapeutic potentials.

Formula: C₃₉H₆₄O₁₃

InChI: InChI=1S/C39H64O13/c1-18-7-12-39(47-17-18)19(2)28-25(52-39)14-24-22-6-5-20-13-21(8-10-37(20,3)23(22)9-11-38(24,28)4)48-36-34(32(45)30(43)27(16-41)50-36)51-35-33(46)31(44)29(42)26(15-40)49-35/h18-36,40-46H,5-17H2,1-4H3/t18-,19-,20+,21-,22+,23-,24-,25-,26+,27+,28-,29+,30-,31-,32-,33+,34+,35-,36+,37-,38-,39+/m0/s1

InChI key: InChIKey=MMTWXUQMLQGAPC-YXOKLLKRSA-N

SMILES: C[C@@]12[C@@]3([C@](C[C@]1([C@]4([C@](CC2)([C@]5(C)[C@](CC4)(C[C@@H](O[C@H]6[C@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)[C@@H](O)[C@@H](O)[C@@H](CO)O6)CC5)[H])[H])[H])[H])(O[C@@]8([C@H]3C)CC[C@H](C)CO8)[H])[H]

Synonyms:

• Timosaponine A III
• Timosaponin A III
• (3β,5β,25S)-Spirostan-3-yl 2-O-β-D-glucopyranosyl-β-D-galactopyranoside
• β-D-Galactopyranoside, (3β,5β,25S)-spirostan-3-yl 2-O-β-D-glucopyranosyl-
• Filiferin B

Timosaponin AIII

CAS: 41059-79-4

Formula: C₃₉H₆₄O₁₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 740.9177

Ref: IN-DA00I81F

Timosaponin AIII

CAS: 41059-79-4

Timosaponin AIII

Purity: ≥98%

Molecular weight: 740.92g/mol

Ref: 54-BUP15158

Timosaponin A-III

CAS: 41059-79-4

Formula: C₃₉H₆₄O₁₃

Molecular weight: 740.93

Ref: 7W-GC0360

Timosaponin AIII

CAS: 41059-79-4

Formula: C₃₉H₆₄O₁₃

Purity: 95%~99%

Molecular weight: 740.928

Ref: BP-BP1395

Timosaponin AIII

CAS: 41059-79-4

Timosaponin AIII triggers autophagy and apoptosis in cancer cells, inhibits mTORC1, and induces ER stress, IC50 as low as 2.5 μM.

Formula: C₃₉H₆₄O₁₃

Purity: 98% - 99.61%

Color and Shape: Solid

Molecular weight: 740.92

Ref: TM-T3395

Timosaponin a iii

CAS: 41059-79-4

Natural glycoside

Formula: C₃₉H₆₄O₁₃

Purity: ≥ 90.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 740.93

Ref: 5G-80545

Timosaponin A-III

CAS: 41059-79-4

Timosaponin A-III is a steroidal saponin, which is a bioactive compound derived from the rhizomes of the plant Anemarrhena asphodeloides, commonly used in traditional Chinese medicine. This compound exerts its effects through various biochemical pathways, primarily by modulating cell signaling pathways such as apoptosis and inflammation. Timosaponin A-III has been shown to influence the NF-κB and MAPK signaling pathways, thereby impacting cellular responses to stress and damage.

Formula: C₃₉H₆₄O₁₃

Purity: Min. 98 Area-%

Color and Shape: Off-White Powder

Molecular weight: 740.92 g/mol

Ref: 3D-OT10477