CAS 41059-79-4
:Timosaponin A III
Description:
Timosaponin A III is a saponin compound primarily derived from the plant species Anemarrhena asphodeloides, which is known for its traditional medicinal uses in East Asian herbal medicine. This compound is characterized by its complex glycosidic structure, which typically includes a steroid aglycone linked to sugar moieties. Timosaponin A III exhibits various biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it a subject of interest in pharmacological research. Its mechanism of action often involves modulation of cellular signaling pathways, contributing to its therapeutic effects. Additionally, saponins like Timosaponin A III are known for their ability to form micelles in solution, which can enhance the solubility and bioavailability of other compounds. However, the specific pharmacokinetics and toxicity profiles of Timosaponin A III require further investigation to fully understand its potential applications in medicine. Overall, Timosaponin A III represents a significant compound in the study of natural products and their therapeutic potentials.
Formula:C39H64O13
InChI:InChI=1S/C39H64O13/c1-18-7-12-39(47-17-18)19(2)28-25(52-39)14-24-22-6-5-20-13-21(8-10-37(20,3)23(22)9-11-38(24,28)4)48-36-34(32(45)30(43)27(16-41)50-36)51-35-33(46)31(44)29(42)26(15-40)49-35/h18-36,40-46H,5-17H2,1-4H3/t18-,19-,20+,21-,22+,23-,24-,25-,26+,27+,28-,29+,30-,31-,32-,33+,34+,35-,36+,37-,38-,39+/m0/s1
InChI key:InChIKey=MMTWXUQMLQGAPC-YXOKLLKRSA-N
SMILES:C[C@@]12[C@@]3([C@](C[C@]1([C@]4([C@](CC2)([C@]5(C)[C@](CC4)(C[C@@H](O[C@H]6[C@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)[C@@H](O)[C@@H](O)[C@@H](CO)O6)CC5)[H])[H])[H])[H])(O[C@@]8([C@H]3C)CC[C@H](C)CO8)[H])[H]
Synonyms:- Timosaponine A III
- Timosaponin A III
- (3β,5β,25S)-Spirostan-3-yl 2-O-β-D-glucopyranosyl-β-D-galactopyranoside
- β-D-Galactopyranoside, (3β,5β,25S)-spirostan-3-yl 2-O-β-D-glucopyranosyl-
- Filiferin B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Timosaponin AIII
CAS:Timosaponin AIII triggers autophagy and apoptosis in cancer cells, inhibits mTORC1, and induces ER stress, IC50 as low as 2.5 μM.Formula:C39H64O13Purity:98% - 99.61%Color and Shape:SolidMolecular weight:740.92Ref: TM-T3395
1mg34.00€5mg66.00€1mL*10mM (DMSO)90.00€10mg105.00€25mg215.00€50mg309.00€100mg464.00€200mg672.00€Timosaponin a iii
CAS:Natural glycosideFormula:C39H64O13Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:740.93Timosaponin A-III
CAS:Timosaponin A-III is a steroidal saponin, which is a bioactive compound derived from the rhizomes of the plant Anemarrhena asphodeloides, commonly used in traditional Chinese medicine. This compound exerts its effects through various biochemical pathways, primarily by modulating cell signaling pathways such as apoptosis and inflammation. Timosaponin A-III has been shown to influence the NF-κB and MAPK signaling pathways, thereby impacting cellular responses to stress and damage.
Formula:C39H64O13Purity:Min. 98 Area-%Color and Shape:Off-White PowderMolecular weight:740.92 g/mol






