CAS 41060-15-5: Neobavaisoflavone
Description:Neobavaisoflavone, with the CAS number 41060-15-5, is a naturally occurring isoflavonoid primarily found in certain plants, particularly in the genus *Neobavaisia*. It is characterized by its chemical structure, which includes a flavonoid backbone, typically featuring two aromatic rings and a heterocyclic ring. This compound exhibits various biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. Neobavaisoflavone is also noted for its ability to interact with estrogen receptors, which may contribute to its effects on hormone-related conditions. In terms of solubility, it is generally more soluble in organic solvents than in water, which is common for many flavonoids. Its stability can be influenced by environmental factors such as light and temperature. Overall, neobavaisoflavone represents a significant compound in the study of natural products and their therapeutic potentials.
Formula:C20H18O4
InChI:InChI=1S/C20H18O4/c1-12(2)3-4-14-9-13(5-8-18(14)22)17-11-24-19-10-15(21)6-7-16(19)20(17)23/h3,5-11,21-22H,4H2,1-2H3
InChI key:InChIKey=OBGPEBYHGIUFBN-UHFFFAOYSA-N
SMILES:O=C1C(=COC2=CC(O)=CC=C12)C=3C=CC(O)=C(C3)CC=C(C)C
- Synonyms:
- 3''-Prenyldaidzein
- 4H-1-Benzopyran-4-one, 7-hydroxy-3-[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-
- 4H-1-Benzopyran-4-one, 7-hydroxy-3-[4-hydroxy-3-(3-methyl-2-butenyl)phenyl]-
- 7-Hydroxy-3-[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-4H-1-benzopyran-4-one
- Neobavaisoflavone
