CAS 41060-15-5
:Neobavaisoflavone
Description:
Neobavaisoflavone, with the CAS number 41060-15-5, is a naturally occurring isoflavonoid primarily found in certain plants, particularly in the genus *Neobavaisia*. It is characterized by its chemical structure, which includes a flavonoid backbone, typically featuring two aromatic rings and a heterocyclic ring. This compound exhibits various biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. Neobavaisoflavone is also noted for its ability to interact with estrogen receptors, which may contribute to its effects on hormone-related conditions. In terms of solubility, it is generally more soluble in organic solvents than in water, which is common for many flavonoids. Its stability can be influenced by environmental factors such as light and temperature. Overall, neobavaisoflavone represents a significant compound in the study of natural products and their therapeutic potentials.
Formula:C20H18O4
InChI:InChI=1S/C20H18O4/c1-12(2)3-4-14-9-13(5-8-18(14)22)17-11-24-19-10-15(21)6-7-16(19)20(17)23/h3,5-11,21-22H,4H2,1-2H3
InChI key:InChIKey=OBGPEBYHGIUFBN-UHFFFAOYSA-N
SMILES:O=C1C(=COC=2C1=CC=C(O)C2)C3=CC(CC=C(C)C)=C(O)C=C3
Synonyms:- 3''-Prenyldaidzein
- 4H-1-Benzopyran-4-one, 7-hydroxy-3-[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-
- 4H-1-Benzopyran-4-one, 7-hydroxy-3-[4-hydroxy-3-(3-methyl-2-butenyl)phenyl]-
- 7-Hydroxy-3-[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-4H-1-benzopyran-4-one
- Neobavaisoflavone
- 4',7-Dihydroxy-3'-(3-methyl-2-butenyl)isoflavone
- 7-hydroxy-3-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]chromen-4-one
- 7-Hydroxy-3-(4-hydroxy-3-(3-methylbut-2-en-1-yl)phenyl)-4H-chromen-4-one
- Neobavaisoavone
- 7-Hydroxy-3-(4-hydroxy-3-(3-methylbut-2-enyl)phenyl)-4H-chromen-4-one
- Neobavaisoflavone, >99%
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Neobavaisoflavone
CAS:Formula:C20H18O4Purity:>97.0%(HPLC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:322.36Neobavaisoflavone
CAS:Neobavaisoflavone, exhibits inhibitory activity against DNA polymerase and platelet aggregation, it also has striking anti-inflammatory and anti-cancer effects, Neobavaisoflavone can significantly inhibit the production of reactive oxygen species (ROS), reactive nitrogen species (RNS) and cytokines: IL-1β, IL-6, IL-12p40, IL-12p70, TNF-α in LPS+IFN-γ- or PMA- stimulated RAW264.7 macrophages.Formula:C20H18O4Purity:95%~99%Molecular weight:322.36Neobavaisoflavone
CAS:Neobavaisoflavone: DNA polymerase inhibitor, potential for treating bone loss, anti-inflammatory, reduces ROS, RNS, cytokines in macrophages.Formula:C20H18O4Purity:99.31% - 99.92%Color and Shape:SolidMolecular weight:322.35Ref: TM-T6S0139
5mg46.00€1mL*10mM (DMSO)49.00€10mg66.00€25mg99.00€50mg144.00€100mg205.00€500mg512.00€Neobavaisoflavone
CAS:Oxygen-heterocyclic compoundFormula:C20H18O4Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:322.363'-Prenyldaidzein
CAS:3'-Prenyldaidzein is a prenylated isoflavone, which is a naturally occurring compound typically derived from plants such as those found in the Fabaceae family. Prenylated isoflavones are characterized by the attachment of a prenyl group to the isoflavone structure, which often enhances their biological activity compared to their non-prenylated counterparts.
Formula:C20H18O4Purity:Min. 95%Color and Shape:PowderMolecular weight:322.35 g/mol









