CAS 41078-15-3

3-amino-4H-thieno[3,4-c]chromen-4-one

Description:

3-amino-4H-thieno[3,4-c]chromen-4-one is a heterocyclic compound characterized by its unique fused ring structure, which incorporates both thieno and chromen moieties. This compound features an amino group (-NH2) at the 3-position, contributing to its potential reactivity and biological activity. The thieno[3,4-c]chromen framework is notable for its aromatic properties, which can influence its electronic characteristics and stability. Typically, compounds of this nature exhibit interesting photophysical properties, making them candidates for applications in organic electronics and fluorescent materials. Additionally, the presence of the amino group may enhance solubility in polar solvents and facilitate interactions with biological targets, suggesting potential pharmacological applications. The compound's molecular structure allows for various substitution patterns, which can further modify its chemical behavior and reactivity. Overall, 3-amino-4H-thieno[3,4-c]chromen-4-one represents a versatile scaffold in medicinal chemistry and materials science, warranting further investigation into its properties and applications.

Formula: C₁₁H₇NO₂S

InChI: InChI=1/C11H7NO2S/c12-10-9-7(5-15-10)6-3-1-2-4-8(6)14-11(9)13/h1-5H,12H2

SMILES: c1ccc2c(c1)c1csc(c1c(=O)o2)N

Synonyms:

• 4H-thieno[3,4-c][1]benzopyran-4-one, 3-amino-

3-Amino-4H-thieno[3,4-c]chromen-4-one

CAS: 41078-15-3

3-Amino-4H-thieno[3,4-c]chromen-4-one

Purity: 97%

Ref: 54-OR1038568

3-amino-4H-thieno[3,4-c]chromen-4-one

CAS: 41078-15-3

Purity: 90.0%

Molecular weight: 217.24000549316406

Ref: 10-F307648