CAS 4108-88-7
:1-Pyrrolidinesulfoamide
Description:
1-Pyrrolidinesulfoamide, with the CAS number 4108-88-7, is an organic compound characterized by the presence of a pyrrolidine ring and a sulfoamide functional group. This compound typically appears as a white to off-white solid and is soluble in polar solvents, reflecting its polar nature due to the sulfonamide group. The sulfoamide moiety contributes to its potential as a versatile reagent in organic synthesis and medicinal chemistry, often serving as a building block for various pharmaceuticals. The presence of the pyrrolidine ring may impart specific steric and electronic properties, influencing its reactivity and interactions with biological targets. Additionally, 1-Pyrrolidinesulfoamide may exhibit properties such as moderate stability under standard conditions, but it can be sensitive to strong acids or bases. Its applications can range from use in synthetic pathways to potential roles in drug development, particularly in the design of inhibitors or modulators of biological processes. As with any chemical, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C4H10N2O2S
InChI:InChI=1S/C4H10N2O2S/c5-9(7,8)6-3-1-2-4-6/h1-4H2,(H2,5,7,8)
SMILES:C1CCN(C1)S(=O)(=O)N
Synonyms:- 1-Pyrrolidinesulfonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Pyrrolidinesulfonamide
CAS:Formula:C4H10N2O2SPurity:97%Color and Shape:SolidMolecular weight:150.1994Pyrrolidine-1-sulphonamide
CAS:<p>Pyrrolidine-1-sulphonamide</p>Purity:98%Molecular weight:150.20g/mol1-Pyrrolidinesulfonamide
CAS:<p>1-Pyrrolidinesulfonamide is an anti-infective agent that inhibits the growth of bacteria by inhibiting their ability to synthesize proteins. It binds to cellular DNA and prevents transcription, leading to apoptotic cell death. 1-Pyrrolidinesulfonamide has been shown to have chemoattractant properties and can be used as a pharmacokinetic marker for differentiating bowel disease from cancer in vivo models. This drug also has been shown to inhibit inflammatory bowel disease in vitro and in vivo. 1-Pyrrolidinesulfonamide is a quinoline derivative that can hydrogen bond with nucleic acids and interfere with RNA synthesis. It also has been shown to inhibit the production of proinflammatory cytokine, such as IL-6 and TNF-α, which are involved in inflammatory diseases.</p>Formula:C4H10N2O2SPurity:Min. 95%Molecular weight:150.2 g/mol



