
CAS 41087-22-3
:Benzene, (trichlorosilyl)-, homopolymer
Description:
Benzene, (trichlorosilyl)-, homopolymer, identified by CAS number 41087-22-3, is a polymer characterized by its structure, which includes benzene rings and trichlorosilyl groups. This compound typically exhibits properties associated with both organic and inorganic materials, resulting in unique characteristics such as thermal stability, chemical resistance, and potential for cross-linking. The presence of trichlorosilyl groups can enhance the polymer's reactivity, allowing for further functionalization or incorporation into composite materials. The polymer may also demonstrate hydrophobic properties due to the benzene rings, making it suitable for applications in coatings, adhesives, and sealants. Additionally, its synthesis often involves processes that can yield varying molecular weights and degrees of polymerization, influencing its physical properties and performance in specific applications. Overall, this homopolymer is of interest in materials science and engineering due to its versatile characteristics and potential uses in advanced materials.
Formula:(C6H5Cl3Si)x
InChI:InChI=1S/C6H5Cl3Si/c7-10(8,9)6-4-2-1-3-5-6/h1-5H
InChI key:InChIKey=ORVMIVQULIKXCP-UHFFFAOYSA-N
SMILES:[Si](Cl)(Cl)(Cl)C1=CC=CC=C1
Synonyms:- Trichlorophenylsilane homopolymer
- Silane, trichlorophenyl-, homopolymer
- Phenyltrichlorosilane homopolymer
- Poly(phenyltrichlorosilane)
- Benzene, (trichlorosilyl)-, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
