CAS 41089-03-6
:(2R,3S,4S,5R,6R)-2-{[(2R,3S,4S,5S,6S)-2-{[(1R)-2-[({6-amino-2-[(1S)-3-amino-1-{[(2S)-2,3-diamino-3-oxopropyl]amino}-3-oxopropyl]-5-methylpyrimidin-4-yl}carbonyl)amino]-3-{[(1R,2S,3S)-2-hydroxy-4-{[(1S,2R)-2-hydroxy-1-{[2-(4-{[3-(methylsulfanyl)propyl]carb
Description:
The chemical substance with the name specified is a complex organic molecule characterized by multiple chiral centers and functional groups, indicating a high degree of stereochemical specificity. It is likely to be a peptide or a related compound, given the presence of amino acid residues and functional groups such as amines and carbonyls. The structure suggests potential biological activity, possibly as a pharmaceutical agent, due to the presence of a pyrimidine ring and various amino acid derivatives. The intricate stereochemistry, denoted by the (R) and (S) configurations, implies that the molecule may exhibit specific interactions with biological targets, which can influence its efficacy and safety profile. Additionally, the presence of sulfur in the form of a methylthio group may contribute to its reactivity and solubility characteristics. Overall, this compound's complexity suggests it may be of interest in medicinal chemistry, particularly in the development of therapeutics targeting specific biological pathways.
Formula:C54H81N17O21S3
InChI:InChI=1/C54H81N17O21S3/c1-19-32(68-45(71-43(19)57)24(11-30(56)75)63-12-23(55)44(58)81)49(85)70-34(40(25-13-60-18-64-25)90-53-42(38(79)36(77)28(14-72)89-53)91-52-39(80)41(92-54(59)87)37(78)29(15-73)88-52)50(86)65-21(3)35(76)20(2)46(82)69-33(22(4)74)48(84)62-9-7-31-66-27(17-94-31)51-67-26(16-95-51)47(83)61-8-6-10-93-5/h13,16-18,20-24,28-29,33-42,52-53,63,72-74,76-80H,6-12,14-15,55H2,1-5H3,(H2,56,75)(H2,58,81)(H2,59,87)(H,60,64)(H,61,83)(H,62,84)(H,65,86)(H,69,82)(H,70,85)(H2,57,68,71)/t20-,21+,22+,23-,24-,28-,29+,33-,34?,35-,36+,37+,38-,39-,40-,41-,42-,52+,53-/m0/s1
Synonyms:- Bleomycin DMA2
- N1-[3-(Methylthio)propyl]bleomycinamide
- Demethylbleomycin A2 (Technical Grade)
- Demethylbleomycin A2
- Demethylbleomycin
- Bleomycinamide, N1-[3-(methylthio)propyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Demethyl bleomycin A2
CAS:Demethyl bleomycin A2 is a Bleomycin congener. The DNA cleavage of demethyl bleomycin A2 is insensitive to the presence of 5-Methylcytidine [1] .Formula:C54H81N17O21S3Color and Shape:SolidMolecular weight:1400.52Demethylbleomycin A2 (Technical Grade)
CAS:Controlled ProductFormula:C54H81N17O21S3Color and Shape:White To Off-WhiteMolecular weight:1400.52Demethylbleomycin A2
CAS:Please enquire for more information about Demethylbleomycin A2 including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C54H81N17O21S3Purity:Min. 95%Molecular weight:1,400.5 g/molRef: 4Z-B-190005
Discontinued product




