CAS 411208-45-2
:2-({2-[(dimethylamino)methyl]phenyl}sulfanyl)-5-methylaniline dihydrochloride
Description:
2-({2-[(Dimethylamino)methyl]phenyl}sulfanyl)-5-methylaniline dihydrochloride, with CAS number 411208-45-2, is a chemical compound characterized by its complex structure that includes a phenyl group, a sulfanyl group, and a dimethylamino moiety. This compound typically appears as a solid, often in the form of a dihydrochloride salt, which enhances its solubility in water and other polar solvents. The presence of the dimethylamino group suggests potential basicity, while the sulfanyl group may impart unique reactivity and interaction capabilities. The compound's molecular structure indicates it may exhibit biological activity, making it of interest in pharmaceutical research. Its synthesis and handling require careful consideration of safety protocols due to the presence of nitrogen and sulfur functionalities, which can influence its reactivity and stability. Overall, this compound's characteristics make it a subject of interest in various fields, including medicinal chemistry and materials science.
Formula:C16H22Cl2N2S
InChI:InChI=1/C16H20N2S.2ClH/c1-12-8-9-16(14(17)10-12)19-15-7-5-4-6-13(15)11-18(2)3;;/h4-10H,11,17H2,1-3H3;2*1H
SMILES:Cc1ccc(c(c1)N)Sc1ccccc1CN(C)C.Cl.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
MADAM
CAS:MADAM demonstrates high affinity and selectivity for 5-HTT, with a Ki value of 1.6 nM. It is utilized as a PET radiotracer for visualizing serotonin transporters.Formula:C16H20N2SColor and Shape:SolidMolecular weight:272.408
