CAS 41122-35-4

2-chloro-3,4-dimethoxy-1-[(E)-2-nitroethenyl]benzene

Description:

2-Chloro-3,4-dimethoxy-1-[(E)-2-nitroethenyl]benzene, with the CAS number 41122-35-4, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chlorine atom, two methoxy groups, and a nitroethenyl group. The presence of the chlorine atom introduces electrophilic properties, while the methoxy groups enhance the electron density of the aromatic system, influencing its reactivity and solubility. The (E)-2-nitroethenyl substituent contributes to the compound's potential as a reactive intermediate in various chemical reactions, particularly in electrophilic aromatic substitution. This compound may exhibit interesting biological activities due to its structural features, making it of interest in medicinal chemistry and materials science. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of its functional groups and the overall molecular structure. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity associated with the nitro group and halogen substituents.

Formula: C₁₀H₁₀ClNO₄

InChI: InChI=1/C10H10ClNO4/c1-15-8-4-3-7(5-6-12(13)14)9(11)10(8)16-2/h3-6H,1-2H3/b6-5+

2-chloro-3,4-dimethoxy-1-(2-nitrovinyl)benzene

CAS: 41122-35-4

Formula: C₁₀H₁₀ClNO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 243.6437

Ref: IN-DA003UW3

2-Chloro-3,4-dimethoxy-β-nitrostyrene

Controlled Product

CAS: 41122-35-4

Applications 2-Chloro-3,4-dimethoxy-β-nitrostyrene is an intermediate in the synthesis of high affinity D1 dopamine receptor ligand.
References Tarantino, P. A., et al.: Toxicol. App. Pharmacol., 27, 507 (1974);

Formula: C₁₀H₁₀ClNO₄

Color and Shape: Neat

Molecular weight: 243.64

Ref: TR-C368190