CAS 411239-21-9

4b,5,6,7,8,8a,9,10-Octahydro-4b,8,8-trimethyl-1-(1-methylethyl)-2-phenanthrenol

Description:

4b,5,6,7,8,8a,9,10-Octahydro-4b,8,8-trimethyl-1-(1-methylethyl)-2-phenanthrenol, with CAS number 411239-21-9, is a complex organic compound characterized by its polycyclic structure, which includes multiple fused rings typical of phenanthrene derivatives. This compound features several methyl groups and an isopropyl group, contributing to its hydrophobic nature and potentially influencing its solubility and reactivity. The presence of hydroxyl (-OH) functional groups indicates that it may exhibit alcohol-like properties, including the ability to participate in hydrogen bonding, which can affect its boiling point and solubility in polar solvents. The stereochemistry of the compound, particularly the arrangement of substituents around the rings, can significantly influence its biological activity and interactions with other molecules. Overall, this compound may have applications in fields such as pharmaceuticals or materials science, although specific uses would depend on further research into its properties and behavior in various environments.

Formula: C₂₀H₃₀O

InChI: InChI=1S/C20H30O/c1-13(2)18-14-7-10-17-19(3,4)11-6-12-20(17,5)15(14)8-9-16(18)21/h8-9,13,17,21H,6-7,10-12H2,1-5H3

InChI key: InChIKey=ZRVDANDJSTYELM-UHFFFAOYSA-N

SMILES: CC12C=3C(=C(C(C)C)C(O)=CC3)CCC1C(C)(C)CCC2

Synonyms:

• 2-Phenanthrenol, 4b,5,6,7,8,8a,9,10-octahydro-4b,8,8-trimethyl-1-(1-methylethyl)-
• 4b,5,6,7,8,8a,9,10-Octahydro-4b,8,8-trimethyl-1-(1-methylethyl)-2-phenanthrenol
• 8,11,13-Totaratrien-13-ol - Thuja plicata (western red cedar)

8,11,13-Totaratrien-13-ol - Thuja plicata (western red cedar)

CAS: 411239-21-9

8,11,13-Totaratrien-13-ol is a sesquiterpene alcohol, which is a bioactive compound derived from the heartwood of Thuja plicata, commonly known as western red cedar. This source is renowned for its complex mixture of organic compounds, which contribute to the wood's natural resistance to decay and pests.

Formula: C₂₀H₃₀O

Purity: Min. 95%

Molecular weight: 286.45 g/mol

Ref: 3D-XT170624