CAS 4113-97-7
:(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)acetate
Description:
(2,4-Dioxo-3,4-dihydropyrimidin-1(2H)-yl)acetate, with the CAS number 4113-97-7, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a pyrimidine ring with two keto groups at positions 2 and 4, contributing to its dioxo characteristic. The presence of a dihydropyrimidine structure indicates that it has a saturated ring system, which can influence its reactivity and stability. The acetate moiety suggests that it is an ester, which can enhance its solubility in organic solvents and may affect its biological activity. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as pyrimidine derivatives often exhibit various pharmacological properties. Its molecular structure allows for interactions with biological targets, making it a candidate for further research in therapeutic contexts. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C6H5N2O4
InChI:InChI=1/C6H6N2O4/c9-4-1-2-8(3-5(10)11)6(12)7-4/h1-2H,3H2,(H,10,11)(H,7,9,12)/p-1
SMILES:c1cn(CC(=O)O)c(=O)nc1O
Synonyms:- 1(2H)-Pyrimidineacetic acid, 3,4-dihydro-2,4-dioxo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(2,4-Dioxo-3,4-dihydro-2h-pyrimidin-1-yl)-acetic acid
CAS:Formula:C6H6N2O4Purity:95%Color and Shape:SolidMolecular weight:170.12282-(2,4-Dioxo-3,4-dihydropyrimidin-1(2H)-yl)acetic acid
CAS:2-(2,4-Dioxo-3,4-dihydropyrimidin-1(2H)-yl)acetic acidPurity:96%Molecular weight:170.12g/mol(2,4-Dioxo-3,4-dihydro-2 H -pyrimidin-1-yl)-acetic acid
CAS:Formula:C6H6N2O4Purity:96%Color and Shape:SolidMolecular weight:170.124(2,4-Dioxo-3,4-dihydropyrimidin-1(2H)-yl)acetic Acid
CAS:Controlled ProductApplications (2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)acetic acid (cas# 4113-97-7) is a useful research chemical.
Formula:C6H6N2O4Color and Shape:NeatMolecular weight:170.1232-(2,4-Dioxo-3,4-dihydropyrimidin-1(2H)-yl)acetic acid
CAS:2-(2,4-Dioxo-3,4-dihydropyrimidin-1(2H)-yl)acetic acid is a useful organic compound for research related to life sciences. The catalog number is T67165 and the CAS number is 4113-97-7.Formula:C6H6N2O4Color and Shape:SolidMolecular weight:170.124




