CAS 41137-10-4
:(2S)-2-[(2R,3S,4R,5S)-3-acetamido-5-[(2S,5S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-2-hydroxy-6-(hydroxymethyl)tetrahydropyran-4-yl]oxypropanoic acid
Description:
The chemical substance with the name "(2S)-2-[(2R,3S,4R,5S)-3-acetamido-5-[(2S,5S)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-2-hydroxy-6-(hydroxymethyl)tetrahydropyran-4-yl]oxypropanoic acid" and CAS number "41137-10-4" is a complex organic molecule characterized by multiple stereocenters and functional groups. It features a propanoic acid backbone, which is modified by various hydroxyl and acetamido groups, contributing to its solubility and reactivity. The presence of tetrahydropyran rings indicates that it has a cyclic structure, which is common in many natural products and pharmaceuticals. This compound is likely to exhibit biological activity due to its structural complexity, potentially interacting with biological macromolecules. Its stereochemistry suggests that it may have specific interactions in biological systems, making it of interest in medicinal chemistry. Additionally, the presence of multiple hydroxyl groups may enhance its hydrogen bonding capabilities, influencing its physical properties such as melting point and solubility in water. Overall, this substance represents a class of compounds that may have significant pharmacological implications.
Formula:C19H32N2O13
InChI:InChI=1/C19H32N2O13/c1-6(17(28)29)31-16-12(21-8(3)25)18(30)32-10(5-23)15(16)34-19-11(20-7(2)24)14(27)13(26)9(4-22)33-19/h6,9-16,18-19,22-23,26-27,30H,4-5H2,1-3H3,(H,20,24)(H,21,25)(H,28,29)/t6-,9?,10?,11?,12-,13+,14?,15+,16+,18+,19-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Acetamido-4-O-(2-acetamido-2-deoxy-b-D-glucopyranosyl)-2-deoxy-D-muramic acid
CAS:Formula:C19H32N2O13Purity:≥ 95%Color and Shape:White, off-white or pale beige solidMolecular weight:496.46N-Acetyl-4-O-[2-(acetylamino)-2-deoxy-ß-D-glucopyranosyl]muramic Acid
CAS:Formula:C19H32N2O13Molecular weight:496.472-Acetamido-4-O-(2-acetamido-2-deoxy-β-D-glucopyranosyl)-2-deoxy-D-muramic acid
CAS:<p>A MurNAc disaccharide</p>Formula:C19H32N2O13Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:496.46 g/mol2-Acetamido-4-O-(2-acetamido-2-deoxy-b-D-glucopyranosyl)-2-deoxy-D-muramic acid
CAS:<p>2-Acetamido-4-O-(2-acetamido-2-deoxy-b-D-glucopyranosyl)-2-deoxy-D-muramic acid is a synthetic, monosaccharide that is used in the synthesis of complex carbohydrates. 2AA2DMUA has been modified with methylation, glycosylation, and fluorination. This product has a CAS No. 41137-10-4 and can be custom synthesized for your needs.</p>Formula:C19H32N2O13Purity:Min. 95%Molecular weight:496.46 g/mol



