CAS 4115-63-3
:methyl 3-(acetylamino)-4,6-O-benzylidene-2,3-dideoxyhexopyranoside
Description:
Methyl 3-(acetylamino)-4,6-O-benzylidene-2,3-dideoxyhexopyranoside, with the CAS number 4115-63-3, is a synthetic carbohydrate derivative characterized by its complex structure, which includes a methyl group, an acetylamino group, and a benzylidene moiety. This compound is a dideoxy sugar, indicating the absence of hydroxyl groups at specific positions on the hexopyranose ring, which influences its reactivity and biological properties. The presence of the benzylidene group enhances its stability and solubility in organic solvents, making it useful in various chemical applications. The acetylamino group can participate in hydrogen bonding, affecting the compound's interactions in biological systems. Methyl 3-(acetylamino)-4,6-O-benzylidene-2,3-dideoxyhexopyranoside may exhibit potential as a glycosyl donor in glycosylation reactions, contributing to the synthesis of more complex carbohydrates or glycosides. Its unique structural features make it a subject of interest in medicinal chemistry and carbohydrate chemistry research, particularly in the development of glycosylated compounds with specific biological activities.
Formula:C16H21NO5
InChI:InChI=1/C16H21NO5/c1-10(18)17-12-8-14(19-2)21-13-9-20-16(22-15(12)13)11-6-4-3-5-7-11/h3-7,12-16H,8-9H2,1-2H3,(H,17,18)
SMILES:CC(=NC1CC(OC)OC2COC(c3ccccc3)OC12)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl 3-Acetamido-4,6-O-benzylidene-2,3-dideoxy-α-D-arabino-hexopyranoside
CAS:Molecular weight:307.34Methyl 3-acetamido-4,6-O-benzylidene-2,3-dideoxy-a-D-arabino-hexopyranoside
CAS:<p>Methyl 3-acetamido-4,6-O-benzylidene-2,3-dideoxy-a-D-arabino-hexopyranoside is a custom synthesis of an oligosaccharide with a complex carbohydrate structure. It is a high purity compound with methylation and glycosylation modifications. This compound has a fluoroination modification that makes it resistant to hydrolysis by esterases and glucuronidases. It can be used in the synthesis of saccharides and polysaccharides.</p>Formula:C16H21NO5Purity:Min. 95%Molecular weight:307.35 g/mol

