CAS 4116-10-3
:2-Chloro-N-methyl-3-oxobutanamide
Description:
2-Chloro-N-methyl-3-oxobutanamide, with the CAS number 4116-10-3, is an organic compound characterized by its amide functional group and a chloro substituent. This compound features a carbonyl group adjacent to a methyl amine, which contributes to its reactivity and potential applications in organic synthesis. The presence of the chloro group enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. The oxobutanamide structure indicates that it has a ketone functionality, which can participate in condensation reactions or serve as a precursor for further synthetic transformations. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amide group. Its chemical properties, such as stability and reactivity, can be influenced by the surrounding functional groups and the overall molecular structure. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks or environmental hazards.
Formula:C5H8ClNO2
InChI:InChI=1S/C5H8ClNO2/c1-3(8)4(6)5(9)7-2/h4H,1-2H3,(H,7,9)
InChI key:InChIKey=XIWMZCRVSYHMER-UHFFFAOYSA-N
SMILES:C(C(NC)=O)(C(C)=O)Cl
Synonyms:- 2-chloro-N-methyl-3-oxobutanamide
- 4116-10-3
- Acetoacetamide, 2-chloro-N-methyl-
- Butanamide, 2-chloro-N-methyl-3-oxo-
- N-Methyl-2-chloroacetoacetamide
- 2-Chloro-N-methylacetoacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Chloro-N-methyl-3-oxobutanamide
CAS:Formula:C5H8ClNO2Color and Shape:SolidMolecular weight:149.57552-Chloro-N-methyl-3-oxo-butanamide
CAS:Controlled ProductApplications 2-Chloro-N-methyl-3-oxo-butanamide is used in the preparation of piperidinylmethyl (thiazolyl)phenylcarbamates which are useful as M3 muscarinic acetylcholine receptor antagonists for the treatment of chronic obstructive lung diseases, chronic bronchitis, asthma, and other disease.
References Laine, D. I., et al.: PCT Int. Appl. (2004), WO 2004012684 A2 20040212Formula:C5H8ClNO2Color and Shape:NeatMolecular weight:149.576

