CAS 41164-59-4
:6-(1,2-dihydroxypentyl)-4-methoxy-5,6-dihydro-2H-pyran-2-one
Description:
6-(1,2-Dihydroxypentyl)-4-methoxy-5,6-dihydro-2H-pyran-2-one, with the CAS number 41164-59-4, is a chemical compound characterized by its unique structure, which includes a pyranone ring. This compound features a methoxy group and a pentyl chain with two hydroxyl groups, contributing to its potential solubility in polar solvents. The presence of hydroxyl groups suggests that it may exhibit hydrogen bonding capabilities, influencing its reactivity and interactions with other molecules. The pyranone moiety indicates that it may participate in various chemical reactions, such as nucleophilic attacks or cyclization processes. This compound may also possess biological activity, making it of interest in fields such as medicinal chemistry or natural product synthesis. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require empirical measurement or literature reference for precise values. Overall, this compound's structural features suggest a versatile role in chemical synthesis and potential applications in pharmaceuticals or agrochemicals.
Formula:C11H18O5
InChI:InChI=1/C11H18O5/c1-3-4-8(12)11(14)9-5-7(15-2)6-10(13)16-9/h6,8-9,11-12,14H,3-5H2,1-2H3
Synonyms:- 6-(1,2-Dihydroxypentyl)-4-methoxy-5,6-dihydropyran-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
LL P880 β
CAS:LL P880 beta is a fungal metabolite.Formula:C11H18O5Color and Shape:SolidMolecular weight:230.26
