CAS 41168-79-0
:Bisdinitrophenylbipyridiniumdichloride; 95%
Description:
Bisdinitrophenylbipyridinium dichloride, with the CAS number 41168-79-0, is a chemical compound characterized by its complex structure, which includes bipyridinium and dinitrophenyl groups. This substance typically appears as a yellow to orange crystalline solid and is known for its high reactivity, particularly in redox reactions. It is often utilized in various chemical applications, including as a reagent in organic synthesis and as a potential intermediate in the production of other chemical compounds. The presence of dichloride ions indicates that it can participate in ionic interactions, enhancing its solubility in polar solvents. Additionally, due to the presence of nitro groups, it may exhibit explosive properties under certain conditions, necessitating careful handling and storage. Safety precautions are essential when working with this compound, as it may pose health risks through inhalation or skin contact. Overall, bisdinitrophenylbipyridinium dichloride is a significant compound in the field of chemistry, particularly in research and industrial applications.
Formula:C22H14Cl2N6O8
InChI:InChI=1/C22H14N6O8.2ClH/c29-25(30)17-1-3-19(21(13-17)27(33)34)23-9-5-15(6-10-23)16-7-11-24(12-8-16)20-4-2-18(26(31)32)14-22(20)28(35)36;;/h1-14H;2*1H/q+2;;/p-2
Synonyms:- 1,1-Bis(2,4-dinitrophenyl)-4,4-bipyridinium dichloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,1'-Bis(2,4-dinitrophenyl)-4,4'-bipyridinium Dichloride
CAS:Formula:C22H14Cl2N6O8Purity:>97.0%(HPLC)Color and Shape:Light yellow to Yellow to Orange powder to crystalMolecular weight:561.291,1'-Bis(2,4-dinitrophenyl)-4,4'-bipyridinium dichloride
CAS:1,1'-Bis(2,4-dinitrophenyl)-4,4'-bipyridinium dichloridePurity:97%Molecular weight:561.29g/mol1,1'-Bis(2,4-dinitrophenyl)-4,4'-bipyridinium dichloride
CAS:Purity:98%Molecular weight:561.28997802734381,1-BIS(2,4-DINITROPHENYL)-4,4-BIPYRIDINIUM DICHLORIDE
CAS:Formula:C22H14Cl2N6O8Purity:97%Color and Shape:SolidMolecular weight:561.2880Ref: IN-DA003D7O
Discontinued product



