CAS 41177-35-9

N-(2-{4-[(cyclohexylcarbamoyl)sulfamoyl]phenyl}ethyl)-2,3-dihydro-1-benzofuran-7-carboxamide

Description:

N-(2-{4-[(cyclohexylcarbamoyl)sulfamoyl]phenyl}ethyl)-2,3-dihydro-1-benzofuran-7-carboxamide, identified by its CAS number 41177-35-9, is a complex organic compound characterized by its unique structural features. This substance contains a benzofuran moiety, which contributes to its aromatic properties and potential biological activity. The presence of a sulfamoyl group indicates that it may exhibit sulfonamide-like characteristics, potentially influencing its pharmacological profile. The cyclohexylcarbamoyl substituent suggests that the compound may interact with biological targets, possibly affecting enzyme activity or receptor binding. Its amide functional group is indicative of potential hydrogen bonding capabilities, which can enhance solubility and stability in biological systems. Overall, this compound's intricate structure may confer specific therapeutic properties, making it of interest in medicinal chemistry and drug development. Further studies would be necessary to elucidate its precise biological activity and potential applications.

Formula: C₂₄H₂₉N₃O₅S

InChI: InChI=1/C24H29N3O5S/c28-23(21-8-4-5-18-14-16-32-22(18)21)25-15-13-17-9-11-20(12-10-17)33(30,31)27-24(29)26-19-6-2-1-3-7-19/h4-5,8-12,19H,1-3,6-7,13-16H2,(H,25,28)(H2,26,27,29)

SMILES: C1CCC(CC1)N=C(NS(=O)(=O)c1ccc(cc1)CCN=C(c1cccc2CCOc12)O)O

CS476

CAS: 41177-35-9

CS476 is a potent drug of hypoglycaemic.

Formula: C₂₄H₂₉N₃O₅S

Purity: 98%

Color and Shape: Solid

Molecular weight: 471.57

Ref: TM-T15013